Androst-4-ene-3,17-dione, dioxime structure
|
Common Name | Androst-4-ene-3,17-dione, dioxime | ||
|---|---|---|---|---|
| CAS Number | 5953-65-1 | Molecular Weight | 316.43800 | |
| Density | 1.33g/cm3 | Boiling Point | 501.4ºC at 760 mmHg | |
| Molecular Formula | C19H28N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 334.4ºC | |
| Name | Androst-4-ene-3,17-dione dioxime |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 501.4ºC at 760 mmHg |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.43800 |
| Flash Point | 334.4ºC |
| Exact Mass | 316.21500 |
| PSA | 65.18000 |
| LogP | 4.60960 |
| Index of Refraction | 1.667 |
| InChIKey | HDKWUWWSIDAZMQ-QAGGRKNESA-N |
| SMILES | CC12CCC(=NO)C=C1CCC1C2CCC2(C)C(=NO)CCC12 |
|
~%
Androst-4-ene-3... CAS#:5953-65-1 |
| Literature: Hershberg Journal of Organic Chemistry, 1948 , vol. 13, p. 542,545 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Androstanolon-propionat |