Androstenedione structure
|
Common Name | Androstenedione | ||
|---|---|---|---|---|
| CAS Number | 63-05-8 | Molecular Weight | 286.409 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 431.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C19H26O2 | Melting Point | 170-173ºC | |
| MSDS | N/A | Flash Point | 161.1±25.7 °C | |
| Symbol |
GHS02, GHS07 |
Signal Word | Danger | |
| Name | androst-4-ene-3,17-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 431.4±45.0 °C at 760 mmHg |
| Melting Point | 170-173ºC |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.409 |
| Flash Point | 161.1±25.7 °C |
| Exact Mass | 286.193268 |
| PSA | 34.14000 |
| LogP | 2.90 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.552 |
| InChIKey | AEMFNILZOJDQLW-QAGGRKNESA-N |
| SMILES | CC12CCC3C(CCC4=CC(=O)CCC43C)C1CCC2=O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS02, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H302 + H312 + H332-H319 |
| Precautionary Statements | P210-P261-P280-P305 + P351 + P338-P370 + P378-P403 + P235 |
| Hazard Codes | Xn |
| Risk Phrases | R40 |
| Safety Phrases | 22-24/25-36 |
| RIDADR | UN 1648 3 / PGII |
| WGK Germany | 3 |
| RTECS | BV8150000 |
| HS Code | 29372900 |
| Precursor 8 | |
|---|---|
| DownStream 8 | |
| HS Code | 29372900 |
|---|
|
Analysis of anabolic androgenic steroids in urine by full-capillary sample injection combined with a sweeping CE stacking method.
Anal. Bioanal. Chem 405(6) , 1969-76, (2013) This study describes an on-line stacking CE approach by sweeping with whole capillary sample filling for analyzing five anabolic androgenic steroids in urine samples. The five anabolic steroids for de... |
|
|
Androgen synthesis in the gonadotropin-suppressed human testes can be markedly suppressed by ketoconazole.
J. Clin. Endocrinol. Metab. 98(3) , 1198-206, (2013) The concentration of intratesticular testosterone (IT-T) required for human spermatogenesis is unknown because spermatogenesis can persist despite the markedly reduced IT-T concentrations observed wit... |
|
|
Metabolism of the polycyclic musk galaxolide and its interference with endogenous and xenobiotic metabolizing enzymes in the European sea bass (Dicentrarchus labrax).
Environ. Pollut. 174 , 214-21, (2013) This study investigates the metabolism and mode of action of galaxolide (HHCB) in the European sea bass -Dicentrarchus labrax- following a single intraperitoneal injection of 50 mg HHCB/kg body weight... |
| Delta-4-Androstene-3,17-Dione |
| Androst-4-ene-3,17-dione |
| D4-Androstenedione |
| Androstendione |
| MFCD00003615 |
| Androstenedione (JAN) |
| EINECS 200-554-5 |
| 17-Ketotestosterone |
| 4-Androsten-3,17-dione |
| δ4-androstenedione |
| Androstenedione |
| ANDERSTERODIONE |