20α,22R-Dihydroxycholesterol structure
|
Common Name | 20α,22R-Dihydroxycholesterol | ||
|---|---|---|---|---|
| CAS Number | 596-94-1 | Molecular Weight | 418.652 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 553.5±25.0 °C at 760 mmHg | |
| Molecular Formula | C27H46O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.1±17.8 °C | |
Use of 20α,22R-Dihydroxycholesterol20α,22R-Dihydroxycholesterol is an endogenous metabolic intermediate. 20α,22R-Dihydroxycholesterol involved in the biosynthesis of cholesterol to steroid hormones[1]. |
| Name | (20R,22R)-20,22-dihydroxycholesterol |
|---|---|
| Synonym | More Synonyms |
| Description | 20α,22R-Dihydroxycholesterol is an endogenous metabolic intermediate. 20α,22R-Dihydroxycholesterol involved in the biosynthesis of cholesterol to steroid hormones[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 553.5±25.0 °C at 760 mmHg |
| Molecular Formula | C27H46O3 |
| Molecular Weight | 418.652 |
| Flash Point | 233.1±17.8 °C |
| Exact Mass | 418.344696 |
| PSA | 60.69000 |
| LogP | 5.98 |
| Vapour Pressure | 0.0±3.4 mmHg at 25°C |
| Index of Refraction | 1.550 |
| InChIKey | ISBSSBGEYIBVTO-TYKWNDPBSA-N |
| SMILES | CC(C)CCC(O)C(C)(O)C1CCC2C3CC=C4CC(O)CCC4(C)C3CCC21C |
|
Name: Binding affinity to ecdysone receptor ligand binding domain in Drosophila melanogaste...
Source: ChEMBL
Target: Ecdysone receptor
External Id: CHEMBL1051107
|
|
Name: Displacement of [3H]-25-OHC from human OSBP overexpressed in HEK293T cell lysate asse...
Source: ChEMBL
Target: Oxysterol-binding protein 1
External Id: CHEMBL5320826
|
|
Name: Displacement of [3H]-25-OHC from human ORP4 overexpressed in HEK293T cell lysate asse...
Source: ChEMBL
Target: Oxysterol-binding protein 2
External Id: CHEMBL5320827
|
| 20α,22R-Dihydroxycholesterol |
| (22R)-20α,22-Dihydroxycholesterol |
| Oxy-16 |
| 20,22-dihydroxycholesterol |
| (3β,22R)-Cholest-5-ene-3,20,22-triol |
| (20R,22R)-20,22-Dihydroxycholesterol |