Cyclohexanoyl-Coenzyme A structure
|
Common Name | Cyclohexanoyl-Coenzyme A | ||
|---|---|---|---|---|
| CAS Number | 5960-12-3 | Molecular Weight | 877.69 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H46N7O17P3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Cyclohexanoyl-Coenzyme ACyclohexanoyl coenzyme A is the active form of cyclohexane carboxylic acid (CHC) from anaerobic degradation in Rhodopseudomonas palustris[1]. |
| Name | cyclohexane-1-carbonyl-CoA |
|---|
| Description | Cyclohexanoyl coenzyme A is the active form of cyclohexane carboxylic acid (CHC) from anaerobic degradation in Rhodopseudomonas palustris[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C28H46N7O17P3S |
|---|---|
| Molecular Weight | 877.69 |
| Exact Mass | 877.18800 |
| PSA | 418.36000 |
| LogP | 1.60800 |
| InChIKey | QRSKGVRHSLILFG-TYHXJLICSA-N |
| SMILES | CC(C)(COP(=O)(O)OP(=O)(O)OCC1OC(n2cnc3c(N)ncnc32)C(O)C1OP(=O)(O)O)C(O)C(=O)NCCC(=O)NCCSC(=O)C1CCCCC1 |