2-Hydroxy-5-sulfobenzoic acid dihydrate structure
|
Common Name | 2-Hydroxy-5-sulfobenzoic acid dihydrate | ||
|---|---|---|---|---|
| CAS Number | 5965-83-3 | Molecular Weight | 254.214 | |
| Density | 0,8 g/cm3 | Boiling Point | 705.7ºC at 760 mmHg | |
| Molecular Formula | C7H10O8S | Melting Point | 105-110 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 150°C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 5-Sulfosalicylic acid dihydrate |
|---|---|
| Synonym | More Synonyms |
| Density | 0,8 g/cm3 |
|---|---|
| Boiling Point | 705.7ºC at 760 mmHg |
| Melting Point | 105-110 °C(lit.) |
| Molecular Formula | C7H10O8S |
| Molecular Weight | 254.214 |
| Flash Point | 150°C |
| Exact Mass | 254.009644 |
| PSA | 138.74000 |
| LogP | 1.28930 |
| InChIKey | BHDKTFQBRFWJKR-UHFFFAOYSA-N |
| SMILES | O.O.O=C(O)c1cc(S(=O)(=O)O)ccc1O |
| Storage condition | Store at RT. |
| Stability | Stable, but light sensitive. Incompatible with strong oxidizing agents. |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319 |
| Precautionary Statements | P301 + P312 + P330-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | C:Corrosive; |
| Risk Phrases | R22;R34 |
| Safety Phrases | S26-S45-S36/37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | VO6500000 |
| HS Code | 2918230000 |
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
|
Brief reports: Lysosomal cross-correction by hematopoietic stem cell-derived macrophages via tunneling nanotubes.
Stem Cells 33(1) , 301-9, (2014) Despite controversies on the potential of hematopoietic stem cells (HSCs) to promote tissue repair, we previously showed that HSC transplantation could correct cystinosis, a multisystemic lysosomal st... |
|
|
Self-immolative polycations as gene delivery vectors and prodrugs targeting polyamine metabolism in cancer.
Mol. Pharm. 12(2) , 332-41, (2015) Polycations are explored as carriers to deliver therapeutic nucleic acids. Polycations are conventionally pharmacological inert with the sole function of delivering therapeutic cargo. This study repor... |
|
|
In vitro evaluation of inorganic mercury and methylmercury effects on the intestinal epithelium permeability.
Food Chem. Toxicol. 74 , 349-59, (2015) The mercurial forms [inorganic divalent mercury, Hg(II) and methylmercury, CH3Hg] produce neurological and immune effects as well as hematological and renal alterations. The main route of exposure is ... |
| MFCD00149540 |
| EINECS 202-555-6 |
| benzoic acid, 2-hydroxy-5-sulfo-, dihydrate |
| sulfosalicylic acid dihydrate |
| Benzoic acid, 2-hydroxy-5-sulfo-, hydrate (1:2) |
| 2-hydroxy-5-sulfobenzoic acid hydrate |
| 5-Sulfosalicylic acid dihydrate |
| 2-Hydroxy-5-sulfobenzoic acid dihydrate |