N-[[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-methylphenyl)-1,2,4-triazol-3-yl]methyl]cyclobutanecarboxamide structure
|
Common Name | N-[[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-methylphenyl)-1,2,4-triazol-3-yl]methyl]cyclobutanecarboxamide | ||
|---|---|---|---|---|
| CAS Number | 5977-82-2 | Molecular Weight | 410.50800 | |
| Density | 1.31g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C22H23FN4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[[5-[(4-fluorophenyl)methylsulfanyl]-4-(4-methylphenyl)-1,2,4-triazol-3-yl]methyl]cyclobutanecarboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Molecular Formula | C22H23FN4OS |
| Molecular Weight | 410.50800 |
| Exact Mass | 410.15800 |
| PSA | 88.60000 |
| LogP | 5.26370 |
| Index of Refraction | 1.662 |
| InChIKey | WWCDHSGVJARBJP-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-n2c(CNC(=O)C3CCC3)nnc2SCc2ccc(F)cc2)cc1 |
| HS Code | 2924299090 |
|---|
|
~99%
N-[[5-[(4-fluor... CAS#:5977-82-2 |
| Literature: Hua, Guoxiong; Li, Yang; Slawin, Alexandra M. Z.; Woollins, J. Derek Organic Letters, 2006 , vol. 8, # 23 p. 5251 - 5254 |
|
~13%
N-[[5-[(4-fluor... CAS#:5977-82-2 |
| Literature: Bhattacharyya, Pravat; Woollins Tetrahedron Letters, 2001 , vol. 42, # 34 p. 5949 - 5951 |
|
~%
N-[[5-[(4-fluor... CAS#:5977-82-2 |
| Literature: v. Dechend Chemische Berichte, 1874 , vol. 7, p. 1273 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Selenobenzoesaeure-amid |
| selenobenzoic amide |
| benzeneselenoamide |
| phenylselenoamide |
| phenylselenocarboxamide |
| selenobenzamide |
| selenobenzoamide |