3-(2-Nitrophenyl)-1H-pyrazole
Modify Date: 2025-08-21 21:52:50
3-(2-Nitrophenyl)-1H-pyrazole structure
|
Common Name | 3-(2-Nitrophenyl)-1H-pyrazole | ||
|---|---|---|---|---|
| CAS Number | 59844-05-2 | Molecular Weight | 189.171 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 409.6±20.0 °C at 760 mmHg | |
| Molecular Formula | C9H7N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.5±21.8 °C | |
| Name | 5-(2-nitrophenyl)-1H-pyrazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 409.6±20.0 °C at 760 mmHg |
| Molecular Formula | C9H7N3O2 |
| Molecular Weight | 189.171 |
| Flash Point | 201.5±21.8 °C |
| Exact Mass | 189.053833 |
| PSA | 74.50000 |
| LogP | 1.77 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.643 |
| InChIKey | LNRBQCSTNUDDGL-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1-c1ccn[nH]1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933199090 |
|
~40%
3-(2-Nitropheny... CAS#:59844-05-2 |
| Literature: Hu, Youhong; Xu, Bin; Liao, Yun; Nawoschik, Kenneth; Liu, Yixin; Sandrasagra, Anthony; Fathi, Reza; Yang, Zhen Patent: US2006/183751 A1, 2006 ; Location in patent: Page/Page column 82 ; |
|
~%
3-(2-Nitropheny... CAS#:59844-05-2 |
| Literature: WO2012/7006 A1, ; Page/Page column 32; 33 ; WO 2012/007006 A1 |
|
~%
3-(2-Nitropheny... CAS#:59844-05-2 |
| Literature: WO2012/7006 A1, ; WO 2012/007006 A1 |
CAS#:111562-32-4| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(2-Nitrophenyl)-1H-pyrazole |
| 1H-Pyrazole, 3-(2-nitrophenyl)- |
| 1H-Pyrazole, 5-(2-nitrophenyl)- |
| 5-(2-Nitrophenyl)-1H-pyrazole |