2,2-Dichloro-1-(4-phenoxyphenyl)ethanone structure
|
Common Name | 2,2-Dichloro-1-(4-phenoxyphenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 59867-68-4 | Molecular Weight | 281.134 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 389.7±32.0 °C at 760 mmHg | |
| Molecular Formula | C14H10Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.4±24.1 °C | |
| Name | 2,2-dichloro-1-(4-phenoxyphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 389.7±32.0 °C at 760 mmHg |
| Molecular Formula | C14H10Cl2O2 |
| Molecular Weight | 281.134 |
| Flash Point | 157.4±24.1 °C |
| Exact Mass | 280.005798 |
| PSA | 26.30000 |
| LogP | 4.62 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | JHGGYGMFCRSWIZ-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(Oc2ccccc2)cc1)C(Cl)Cl |
| HS Code | 2914700090 |
|---|
|
~%
2,2-Dichloro-1-... CAS#:59867-68-4 |
| Literature: J. Med. Chem., , vol. 6, p. 573 - 578 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2,2-Dichloro-1-(4-phenoxyphenyl)ethanone |
| 4'-Phenoxy-2,2-dichloroacetophenone |
| Ethanone, 2,2-dichloro-1-(4-phenoxyphenyl)- |
| Ethanone,2,2-dichloro-1-(4-phenoxyphenyl) |
| EINECS 261-966-9 |
| 2,2-DIBROMO-1-METHYLCYCLOPROPANECARBOXYLIC ACID |
| 2,2-dichloro-1-(4-phenoxyphenyl)ethan-1-one |