1-chloro-2-(4-methylphenyl)sulfonyloxy-benzene
Modify Date: 2024-02-07 22:36:43
1-chloro-2-(4-methylphenyl)sulfonyloxy-benzene structure
|
Common Name | 1-chloro-2-(4-methylphenyl)sulfonyloxy-benzene | ||
|---|---|---|---|---|
| CAS Number | 599-76-8 | Molecular Weight | 282.74300 | |
| Density | 1.337g/cm3 | Boiling Point | 415.4ºC at 760 mmHg | |
| Molecular Formula | C13H11ClO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205ºC | |
| Name | (2-chlorophenyl) 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.337g/cm3 |
|---|---|
| Boiling Point | 415.4ºC at 760 mmHg |
| Molecular Formula | C13H11ClO3S |
| Molecular Weight | 282.74300 |
| Flash Point | 205ºC |
| Exact Mass | 282.01200 |
| PSA | 51.75000 |
| LogP | 4.49690 |
| Index of Refraction | 1.591 |
| InChIKey | BYUBPRJLQIPXQT-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccccc2Cl)cc1 |
|
~82%
1-chloro-2-(4-m... CAS#:599-76-8 |
| Literature: Reddy, M. B. Madhusudana; Pasha Phosphorus, Sulfur and Silicon and the Related Elements, 2011 , vol. 186, # 9 p. 1867 - 1875 |
|
~%
1-chloro-2-(4-m... CAS#:599-76-8 |
| Literature: Bennett; Brooks; Glasstone Journal of the Chemical Society, 1935 , p. 1821,1825 |
CAS#:104-15-4
CAS#:92023-24-0| Toluol-4-sulfonsaeure-(2-chlor-phenylester) |
| toluene-4-sulfonic acid-(2-chloro-phenyl ester) |
| 2-chlorophenyltosylate |
| 2-chlorophenyl 4-methylbenzenesulfonate |
| o-Chlorphenyltosylat |
| 2-Chlorphenyl-tosylat |
| 2-chlorophenol tosylate |