4-Butyl-1,2-diphenyl-3-pyrazolin-5-one structure
|
Common Name | 4-Butyl-1,2-diphenyl-3-pyrazolin-5-one | ||
|---|---|---|---|---|
| CAS Number | 60002-09-7 | Molecular Weight | 292.37500 | |
| Density | 1.135g/cm3 | Boiling Point | 415.3ºC at 760 mmHg | |
| Molecular Formula | C19H20N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.2ºC | |
| Name | 4-butyl-1,2-diphenylpyrazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.135g/cm3 |
|---|---|
| Boiling Point | 415.3ºC at 760 mmHg |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.37500 |
| Flash Point | 170.2ºC |
| Exact Mass | 292.15800 |
| PSA | 26.93000 |
| LogP | 3.97080 |
| Index of Refraction | 1.6 |
| InChIKey | PBPQFHAXZZKRNX-UHFFFAOYSA-N |
| SMILES | CCCCc1cn(-c2ccccc2)n(-c2ccccc2)c1=O |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Butyl-1,2-dihydro-1,2-diphenyl-3H-pyrazol-3-one |
| 3-Pyrazolin-5-one,4-butyl-1,2-diphenyl |
| 4-Butyl-1,2-diphenyl-3-pyrazolin-5-one |
| 4-n-Butyl-1,2-diphenyl-5-pyrazolone |
| 4-butyl-1,2-diphenyl-1,2-dihydro-pyrazol-3-one |
| 4-BUTYL-1,2-DIPHENYL-5-PYRAZOLONE |