4-Butyl-1,2-diphenyl-3-methoxy-3-pyrazolin-5-one structure
|
Common Name | 4-Butyl-1,2-diphenyl-3-methoxy-3-pyrazolin-5-one | ||
|---|---|---|---|---|
| CAS Number | 27258-01-1 | Molecular Weight | 322.40100 | |
| Density | 1.18g/cm3 | Boiling Point | 448.8ºC at 760mmHg | |
| Molecular Formula | C20H22N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.2ºC | |
| Name | 4-butyl-5-methoxy-1,2-diphenylpyrazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 448.8ºC at 760mmHg |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.40100 |
| Flash Point | 225.2ºC |
| Exact Mass | 322.16800 |
| PSA | 36.16000 |
| LogP | 3.97940 |
| Vapour Pressure | 3.01E-08mmHg at 25°C |
| Index of Refraction | 1.621 |
| InChIKey | HZWCYMHYZRAXMH-UHFFFAOYSA-N |
| SMILES | CCCCc1c(OC)n(-c2ccccc2)n(-c2ccccc2)c1=O |
| HS Code | 2933199090 |
|---|
|
~%
4-Butyl-1,2-dip... CAS#:27258-01-1 |
| Literature: Hammond et al. Journal of the Chemical Society, 1957 , p. 1062,1063 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Butyl-5-methoxy-1,2-diphenyl-1,2-dihydro-3H-pyrazol-3-one |
| 3-Pyrazolin-5-one,4-butyl-1,2-diphenyl-3-methoxy |
| O-Methylphenylbutazon |
| 4-Butyl-1,2-diphenyl-3-methoxy-3-pyrazolin-5-one |
| 4-butyl-5-methoxy-1,2-diphenyl-1,2-dihydro-pyrazol-3-one |
| 3-Methoxy-4-n-butyl-1,2-diphenyl-5-pyrazolone |