Oblongine structure
|
Common Name | Oblongine | ||
|---|---|---|---|---|
| CAS Number | 60008-01-7 | Molecular Weight | 314.398 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H24NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of OblongineOblongine is isolated from the tuber of Stephania cambodica. |
| Name | (1S)-1-[(4-hydroxyphenyl)methyl]-7-methoxy-2,2-dimethyl-3,4-dihydro-1H-isoquinolin-2-ium-8-ol |
|---|---|
| Synonym | More Synonyms |
| Description | Oblongine is isolated from the tuber of Stephania cambodica. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C19H24NO3 |
|---|---|
| Molecular Weight | 314.398 |
| Exact Mass | 314.175079 |
| PSA | 49.69000 |
| LogP | -1.91 |
| InChIKey | POJZOQWVMMYVBU-INIZCTEOSA-O |
| SMILES | COc1ccc2c(c1O)C(Cc1ccc(O)cc1)[N+](C)(C)CC2 |
| Hazard Codes | Xi |
|---|
| Oblongine chloride |
| Oblongine |
| Isoquinolinium, 1,2,3,4-tetrahydro-8-hydroxy-1-[(4-hydroxyphenyl)methyl]-7-methoxy-2,2-dimethyl-, (1S)- |
| (1S)-8-Hydroxy-1-(4-hydroxybenzyl)-7-methoxy-2,2-dimethyl-1,2,3,4-tetrahydroisoquinolinium |