3-Oxo-2,3-dihydro-1H-indene-5-carboxylic acid structure
|
Common Name | 3-Oxo-2,3-dihydro-1H-indene-5-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 60031-08-5 | Molecular Weight | 176.169 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 375.2±31.0 °C at 760 mmHg | |
| Molecular Formula | C10H8O3 | Melting Point | 256-260ºC | |
| MSDS | Chinese USA | Flash Point | 194.9±21.3 °C | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | 3-oxo-1,2-dihydroindene-5-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 375.2±31.0 °C at 760 mmHg |
| Melting Point | 256-260ºC |
| Molecular Formula | C10H8O3 |
| Molecular Weight | 176.169 |
| Flash Point | 194.9±21.3 °C |
| Exact Mass | 176.047348 |
| PSA | 54.37000 |
| LogP | 2.00 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.632 |
| InChIKey | BIABIACQHKYEEB-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)CC2 |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H315-H319-H335 |
| Precautionary Statements | P261-P301 + P310-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Phrases | 25-36/37/38 |
| Safety Phrases | 26-36/37/39-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HS Code | 2918300090 |
|
~88%
3-Oxo-2,3-dihyd... CAS#:60031-08-5 |
| Literature: Gruenenthal GmbH Patent: US2010/249095 A1, 2010 ; Location in patent: Page/Page column 68-69 ; US 20100249095 A1 |
|
~%
3-Oxo-2,3-dihyd... CAS#:60031-08-5 |
| Literature: WO2005/95387 A1, ; Page/Page column 60 ; WO 2005/095387 A1 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| indanone-6-carboxylic acid |
| 3-Oxo-indan-5-carbonsaeure |
| 2,3-Dihydro-3-oxo-1H-indene-5-carboxylic acid |
| 6-carboxy-1-indanone |
| 3-Oxo-indan-5-carboxylic acid |
| indanone-6-carboxilic acid |
| MFCD02179295 |
| 3-oxoindane-5-carboxylic acid |
| 1-Indanone-6-carboxylic acid |
| 3-Oxo-5-indanecarboxylic acid |
| Indan-1-one-6-carboxylic acid |