acetic acid,2,6-bis(bromomethyl)phenol
acetic acid,2,6-bis(bromomethyl)phenol structure
|
Common Name | acetic acid,2,6-bis(bromomethyl)phenol | ||
|---|---|---|---|---|
| CAS Number | 60041-69-2 | Molecular Weight | 340.00800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12Br2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2,6-Bis(bromomethyl)phenol (Acetic acid, 2,6-bis(bromomethyl)phenol, CAS: 60041-69-2), molecular formula C10H12Br2O3, molecular weight 340.00800. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | acetic acid,2,6-bis(bromomethyl)phenol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H12Br2O3 |
|---|---|
| Molecular Weight | 340.00800 |
| Exact Mass | 337.91500 |
| PSA | 57.53000 |
| LogP | 3.27290 |
| InChIKey | MZGNVACJECJXHA-UHFFFAOYSA-N |
| SMILES | CC(=O)O.Oc1c(CBr)cccc1CBr |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~69%
acetic acid,2,6... CAS#:60041-69-2 |
| Literature: Lee, Dong Hoon; Lee, Ho Yong; Lee, Kwan Hee; Hong, Jong-In Chemical Communications (Cambridge, United Kingdom), 2001 , # 13 p. 1188 - 1189 |
|
~%
acetic acid,2,6... CAS#:60041-69-2 |
| Literature: Battaini, Giuseppe; Monzani, Enrico; Perotti, Angelo; Para, Cristina; Casella, Luigi; Santagostini, Laura; Gullotti, Michele; Dillinger, Renee; Naether, Christian; Tuczek, Felix Journal of the American Chemical Society, 2003 , vol. 125, # 14 p. 4185 - 4198 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Essigsaeure-<2,6-bis(brommethyl)phenylester>Phenol,2,6-bis(bromomethyl)-,acetate |
| 2,6-bis(bromomethyl)phenylacetate |
| 2,6-bis(bromomethyl)phenoxy acetate |
| acetic acid 2,6-bis-bromomethylphenyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 60041-69-2? |
| A: Chinese name of 60041-69-2 is 60041-69-2. |
| Q: What is the InChIKey of acetic acid,2,6-bis(bromomethyl)phenol? |
| A: InChIKey of acetic acid,2,6-bis(bromomethyl)phenol is MZGNVACJECJXHA-UHFFFAOYSA-N. |
| Q: What is the molecular formula of acetic acid,2,6-bis(bromomethyl)phenol? |
| A: Molecular formula of acetic acid,2,6-bis(bromomethyl)phenol is C10H12Br2O3. |
| Q: What English synonyms does acetic acid,2,6-bis(bromomethyl)phenol have? |
| A: English synonyms of acetic acid,2,6-bis(bromomethyl)phenol: Essigsaeure-Phenol,2,6-bis(bromomethyl)-,acetate, 2,6-bis(bromomethyl)phenylacetate, 2,6-bis(bromomethyl)phenoxy acetate, acetic acid 2,6-bis-bromomethylphenyl ester. |
| Q: What is the English name of acetic acid,2,6-bis(bromomethyl)phenol? |
| A: The English name of acetic acid,2,6-bis(bromomethyl)phenol is acetic acid,2,6-bis(bromomethyl)phenol. |
| Q: What is the CAS number of acetic acid,2,6-bis(bromomethyl)phenol? |
| A: CAS number of acetic acid,2,6-bis(bromomethyl)phenol is 60041-69-2. |
| Q: What is the SMILES notation of acetic acid,2,6-bis(bromomethyl)phenol? |
| A: SMILES notation of acetic acid,2,6-bis(bromomethyl)phenol is CC(=O)O.Oc1c(CBr)cccc1CBr. |
| Q: What is the molecular weight of acetic acid,2,6-bis(bromomethyl)phenol? |
| A: Molecular weight of acetic acid,2,6-bis(bromomethyl)phenol is 340.00800. |
| Q: What is the polar surface area (PSA) of acetic acid,2,6-bis(bromomethyl)phenol? |
| A: Polar surface area (PSA) of acetic acid,2,6-bis(bromomethyl)phenol is 57.53000. |
| Q: What is the LogP of acetic acid,2,6-bis(bromomethyl)phenol? |
| A: LogP of acetic acid,2,6-bis(bromomethyl)phenol is 3.27290. |