acetic acid,2,6-bis(bromomethyl)phenol structure
|
Common Name | acetic acid,2,6-bis(bromomethyl)phenol | ||
|---|---|---|---|---|
| CAS Number | 60041-69-2 | Molecular Weight | 340.00800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H12Br2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | acetic acid,2,6-bis(bromomethyl)phenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H12Br2O3 |
|---|---|
| Molecular Weight | 340.00800 |
| Exact Mass | 337.91500 |
| PSA | 57.53000 |
| LogP | 3.27290 |
| InChIKey | MZGNVACJECJXHA-UHFFFAOYSA-N |
| SMILES | CC(=O)O.Oc1c(CBr)cccc1CBr |
|
~69%
acetic acid,2,6... CAS#:60041-69-2 |
| Literature: Lee, Dong Hoon; Lee, Ho Yong; Lee, Kwan Hee; Hong, Jong-In Chemical Communications (Cambridge, United Kingdom), 2001 , # 13 p. 1188 - 1189 |
|
~%
acetic acid,2,6... CAS#:60041-69-2 |
| Literature: Battaini, Giuseppe; Monzani, Enrico; Perotti, Angelo; Para, Cristina; Casella, Luigi; Santagostini, Laura; Gullotti, Michele; Dillinger, Renee; Naether, Christian; Tuczek, Felix Journal of the American Chemical Society, 2003 , vol. 125, # 14 p. 4185 - 4198 |
| Essigsaeure-<2,6-bis(brommethyl)phenylester>Phenol,2,6-bis(bromomethyl)-,acetate |
| 2,6-bis(bromomethyl)phenylacetate |
| 2,6-bis(bromomethyl)phenoxy acetate |
| acetic acid 2,6-bis-bromomethylphenyl ester |