ethyl 4-bromo-6,6,6-trichloro-3,3-dimethylhexanoate structure
|
Common Name | ethyl 4-bromo-6,6,6-trichloro-3,3-dimethylhexanoate | ||
|---|---|---|---|---|
| CAS Number | 60066-54-8 | Molecular Weight | 354.49600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H16BrCl3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 4-bromo-6,6,6-trichloro-3,3-dimethylhexanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H16BrCl3O2 |
|---|---|
| Molecular Weight | 354.49600 |
| Exact Mass | 351.94000 |
| PSA | 26.30000 |
| LogP | 4.48960 |
| InChIKey | XASJSFQFRFTHAL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(C)(C)C(Br)CC(Cl)(Cl)Cl |
|
~87%
ethyl 4-bromo-6... CAS#:60066-54-8 |
| Literature: Sagami Chemical Research Center Patent: US4214097 A1, 1980 ; |
|
~88%
ethyl 4-bromo-6... CAS#:60066-54-8 |
| Literature: Matsui, Kiyohide; Negishi, Akira; Takahatake, Yuriko; Sugimoto, Kikuo; Fujimoto, Tamotsu; et al. Bulletin of the Chemical Society of Japan, 1986 , vol. 59, # 1 p. 221 - 228 |
| 4-Brom-6,6,6-trichlor-3,3-dimethyl-hexansaeure-ethylester |
| Ethyl 4-Brom-6,6,6-trichlor-3,3-dimethylhexanoat |
| ethyl 3,3-dimethyl-4-bromo-6,6,6-trichlorohexanoate |
| Hexanoic acid,4-bromo-6,6,6-trichloro-3,3-dimethyl-,ethyl ester |