β-Aspartylaspartic acid structure
|
Common Name | β-Aspartylaspartic acid | ||
|---|---|---|---|---|
| CAS Number | 60079-22-3 | Molecular Weight | 248.190 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 594.1±50.0 °C at 760 mmHg | |
| Molecular Formula | C8H12N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 313.1±30.1 °C | |
Use of β-Aspartylaspartic acidβ-Aspartylaspartic acid is a natural compound found in Asparagus (Asparagus officinalis) Shoots[1]. |
| Name | 2-[(3-amino-3-carboxypropanoyl)amino]butanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Description | β-Aspartylaspartic acid is a natural compound found in Asparagus (Asparagus officinalis) Shoots[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 594.1±50.0 °C at 760 mmHg |
| Molecular Formula | C8H12N2O7 |
| Molecular Weight | 248.190 |
| Flash Point | 313.1±30.1 °C |
| Exact Mass | 248.064453 |
| PSA | 167.02000 |
| LogP | -1.33 |
| Vapour Pressure | 0.0±3.6 mmHg at 25°C |
| Index of Refraction | 1.571 |
| InChIKey | KXAWLANLJYMEGB-UHFFFAOYSA-N |
| SMILES | NC(CC(=O)NC(CC(=O)O)C(=O)O)C(=O)O |
| Hazard Codes | Xi |
|---|
| L-Aspartic acid, L-β-aspartyl- |
| A-aspartylaspartic acid |
| L-β-Aspartyl-L-aspartic acid |
| (3-Amino-3-carboxy-propionylamino)-bernsteinsaeure |
| b-Asp-Asp |
| L-Ornithine L-Aspartate Impurity 2 |