3-bromo-4-methoxy-N-naphthalen-2-ylbenzenesulfonamide structure
|
Common Name | 3-bromo-4-methoxy-N-naphthalen-2-ylbenzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 6010-85-1 | Molecular Weight | 392.26700 | |
| Density | 1.551g/cm3 | Boiling Point | 541.9ºC at 760mmHg | |
| Molecular Formula | C17H14BrNO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281.5ºC | |
| Name | 3-bromo-4-methoxy-N-naphthalen-2-ylbenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.551g/cm3 |
|---|---|
| Boiling Point | 541.9ºC at 760mmHg |
| Molecular Formula | C17H14BrNO3S |
| Molecular Weight | 392.26700 |
| Flash Point | 281.5ºC |
| Exact Mass | 390.98800 |
| PSA | 63.78000 |
| LogP | 5.56550 |
| Index of Refraction | 1.68 |
| InChIKey | SNWNXWNBFWOLHZ-UHFFFAOYSA-N |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc3ccccc3c2)cc1Br |
|
~%
3-bromo-4-metho... CAS#:6010-85-1 |
| Literature: Wintersteiner; Allen Journal of Biological Chemistry, 1934 , vol. 107, p. 321,332 |
| 3-bromo-4-methoxy-N-(naphthalen-2-yl)benzenesulfonamide |