N-[bis(2-chloroethyl)amino-chloro-phosphoryl]-N-ethyl-ethanamine structure
|
Common Name | N-[bis(2-chloroethyl)amino-chloro-phosphoryl]-N-ethyl-ethanamine | ||
|---|---|---|---|---|
| CAS Number | 60106-93-6 | Molecular Weight | 295.57400 | |
| Density | 1.266g/cm3 | Boiling Point | 345.2ºC at 760 mmHg | |
| Molecular Formula | C8H18Cl3N2OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.6ºC | |
| Name | 2-chloro-N-[chloro(diethylamino)phosphoryl]-N-(2-chloroethyl)ethanamine |
|---|
| Density | 1.266g/cm3 |
|---|---|
| Boiling Point | 345.2ºC at 760 mmHg |
| Molecular Formula | C8H18Cl3N2OP |
| Molecular Weight | 295.57400 |
| Flash Point | 162.6ºC |
| Exact Mass | 294.02200 |
| PSA | 33.36000 |
| LogP | 3.45470 |
| Index of Refraction | 1.494 |
| InChIKey | RCUAZAMLVYMGAG-UHFFFAOYSA-N |
| SMILES | CCN(CC)P(=O)(Cl)N(CCCl)CCCl |
|
~73%
N-[bis(2-chloro... CAS#:60106-93-6 |
| Literature: Wan, Huijie; Modro, Tomasz A. Phosphorus, Sulfur and Silicon and Related Elements, 1996 , vol. 108, # 1-4 p. 155 - 168 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |