1-[4-[4-(4-acetylphenyl)butyl]phenyl]ethanone structure
|
Common Name | 1-[4-[4-(4-acetylphenyl)butyl]phenyl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 6016-43-9 | Molecular Weight | 294.38700 | |
| Density | 1.055g/cm3 | Boiling Point | 457.1ºC at 760 mmHg | |
| Molecular Formula | C20H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.2ºC | |
| Name | 1-[4-[4-(4-acetylphenyl)butyl]phenyl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.055g/cm3 |
|---|---|
| Boiling Point | 457.1ºC at 760 mmHg |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.38700 |
| Flash Point | 170.2ºC |
| Exact Mass | 294.16200 |
| PSA | 34.14000 |
| LogP | 4.65720 |
| Index of Refraction | 1.555 |
| InChIKey | ZSNMJPFJWCHOJK-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(CCCCc2ccc(C(C)=O)cc2)cc1 |
|
~%
1-[4-[4-(4-acet... CAS#:6016-43-9 |
| Literature: Cram; Allinger Journal of the American Chemical Society, 1954 , vol. 76, p. 726,730 |
|
~%
1-[4-[4-(4-acet... CAS#:6016-43-9 |
| Literature: Sloan; Vaughan Journal of Organic Chemistry, 1957 , vol. 22, p. 750,759 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4,4'-Diacetyl-1,4-diphenylbutan |
| p,p'-Tetramethylen-diacetophenon |
| HMS3087I09 |