2,3,4-TRINITROTOLUENE structure
|
Common Name | 2,3,4-TRINITROTOLUENE | ||
|---|---|---|---|---|
| CAS Number | 602-29-9 | Molecular Weight | 227.13100 | |
| Density | 1.608 g/cm3 | Boiling Point | 431.8ºC at 760 mmHg | |
| Molecular Formula | C7H5N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.5ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3,4-Trinitrotoluene,1-Methyl-2,3,4-trinitrobenzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.608 g/cm3 |
|---|---|
| Boiling Point | 431.8ºC at 760 mmHg |
| Molecular Formula | C7H5N3O6 |
| Molecular Weight | 227.13100 |
| Flash Point | 231.5ºC |
| Exact Mass | 227.01800 |
| PSA | 137.46000 |
| LogP | 3.28920 |
| Index of Refraction | 1.637 |
| InChIKey | FPKOPBFLPLFWAD-UHFFFAOYSA-N |
| SMILES | Cc1ccc([N+](=O)[O-])c([N+](=O)[O-])c1[N+](=O)[O-] |
This table summarizes toxicological test data, acute & chronic toxicity and ecological hazard parameters for this chemical.
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATAMUTATION DATA
|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 6 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,3,4-trinitro-toluen |
| 2,3,4-TRINITRO-METHYLBENZENE |
| 2,3,4-Trinitro-toluol |
| 2,3,4-TRINITROTOLUENE |
| 1-methyl-2,3,4-trinitro-benzen |
| 2,3,4,5,6-PENTAFLUOROPHENYL2-FLUOROBENZENESULFONATE |
| trinitrotoluene |
| 1-METHYL-2,3,4-TRINITROBENZENE |
| Benzene,1-methyl-2,3,4-trinitro |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 2,3,4-Trinitrotoluene,1-Methyl-2,3,4-trinitrobenzene? |
| A: LogP of 2,3,4-Trinitrotoluene,1-Methyl-2,3,4-trinitrobenzene is 3.28920. |
| Q: What is the InChIKey of 2,3,4-Trinitrotoluene,1-Methyl-2,3,4-trinitrobenzene? |
| A: InChIKey of 2,3,4-Trinitrotoluene,1-Methyl-2,3,4-trinitrobenzene is FPKOPBFLPLFWAD-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2,3,4-Trinitrotoluene,1-Methyl-2,3,4-trinitrobenzene? |
| A: SMILES notation of 2,3,4-Trinitrotoluene,1-Methyl-2,3,4-trinitrobenzene is Cc1ccc([N+](=O)[O-])c([N+](=O)[O-])c1[N+](=O)[O-]. |
| Q: What are the upstream materials of 2,3,4-Trinitrotoluene,1-Methyl-2,3,4-trinitrobenzene? |
| A: Related upstream materials(CAS) of 2,3,4-Trinitrotoluene,1-Methyl-2,3,4-trinitrobenzene: 602-01-7;99-08-1;70343-09-8;610-39-9;3484-29-5;2879-79-0;2719-14-4;7664-93-9;108-88-3. |
| Q: What is the boiling point of 2,3,4-Trinitrotoluene,1-Methyl-2,3,4-trinitrobenzene? |
| A: Boiling point of 2,3,4-Trinitrotoluene,1-Methyl-2,3,4-trinitrobenzene is 431.8ºC at 760 mmHg. |
| Q: What is the English name of 2,3,4-Trinitrotoluene,1-Methyl-2,3,4-trinitrobenzene? |
| A: The English name of 2,3,4-Trinitrotoluene,1-Methyl-2,3,4-trinitrobenzene is 2,3,4-Trinitrotoluene,1-Methyl-2,3,4-trinitrobenzene. |
| Q: What is the CAS number of 2,3,4-Trinitrotoluene,1-Methyl-2,3,4-trinitrobenzene? |
| A: CAS number of 2,3,4-Trinitrotoluene,1-Methyl-2,3,4-trinitrobenzene is 602-29-9. |
| Q: What is the polar surface area (PSA) of 2,3,4-Trinitrotoluene,1-Methyl-2,3,4-trinitrobenzene? |
| A: Polar surface area (PSA) of 2,3,4-Trinitrotoluene,1-Methyl-2,3,4-trinitrobenzene is 137.46000. |
| Q: What is the molecular weight of 2,3,4-Trinitrotoluene,1-Methyl-2,3,4-trinitrobenzene? |
| A: Molecular weight of 2,3,4-Trinitrotoluene,1-Methyl-2,3,4-trinitrobenzene is 227.13100. |
| Q: What English synonyms does 2,3,4-Trinitrotoluene,1-Methyl-2,3,4-trinitrobenzene have? |
| A: English synonyms of 2,3,4-Trinitrotoluene,1-Methyl-2,3,4-trinitrobenzene: 2,3,4-trinitro-toluen, 2,3,4-TRINITRO-METHYLBENZENE, 2,3,4-Trinitro-toluol, 2,3,4-TRINITROTOLUENE, 1-methyl-2,3,4-trinitro-benzen, 2,3,4,5,6-PENTAFLUOROPHENYL2-FLUOROBENZENESULFONATE, trinitrotoluene, 1-METHYL-2,3,4-TRINITROBENZENE, Benzene,1-methyl-2,3,4-trinitro. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |