9-Nitroanthracene structure
|
Common Name | 9-Nitroanthracene | ||
|---|---|---|---|---|
| CAS Number | 602-60-8 | Molecular Weight | 223.227 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 402.9±14.0 °C at 760 mmHg | |
| Molecular Formula | C14H9NO2 | Melting Point | 144-144ºC | |
| MSDS | Chinese USA | Flash Point | 200.4±12.9 °C | |
| Name | 9-Nitroanthracene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 402.9±14.0 °C at 760 mmHg |
| Melting Point | 144-144ºC |
| Molecular Formula | C14H9NO2 |
| Molecular Weight | 223.227 |
| Flash Point | 200.4±12.9 °C |
| Exact Mass | 223.063324 |
| PSA | 45.82000 |
| LogP | 4.41 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.742 |
| InChIKey | LSIKFJXEYJIZNB-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1c2ccccc2cc2ccccc12 |
| Storage condition | 2-8°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATAMUTATION DATA
|
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | CB0715000 |
| Precursor 9 | |
|---|---|
| DownStream 9 | |
|
Preparation, Structural Determination, and Characterization of Electronic Properties of Bis-silylated and Bis-germylated Lu3 N@Ih -C80.
Chemistry 21 , 16411-20, (2015) Bis-silylated and bis-germylated derivatives of Lu3 N@Ih -C80 (3, 4, 5) were successfully synthesized by the photochemical addition of disiliranes 1 a, 1 b or digermirane 2, and fully characterized by... |
|
|
9-Nitroanthracene derivative as a precursor of anthraquinone for photodynamic therapy.
Bioorg. Med. Chem. 15(11) , 3869-73, (2007) Anthraquinones are typical photosensitizers used in photodynamic therapy (PDT). However, systemic toxicity is a major problem for anthraquinones due to their ability not only to bind DNA but also to c... |
|
|
Xanthine oxidase-catalyzed DNA binding of dihydrodiol derivatives of nitro-polycyclic aromatic hydrocarbons.
Biochem. Biophys. Res. Commun. 141(1) , 245-50, (1986) Xanthine oxidase, a mammalian nitroreductase, catalyzed the covalent binding of a series of nitro-polycyclic aromatic hydrocarbons (nitro-PAHs) trans-dihydrodiols to DNA. Some of the trans-dihydrodiol... |
| EINECS 210-021-9 |
| MFCD00001248 |
| Anthracene, 9-nitro- |
| 9-Nitroanthracene |