1,3-dibromoanthracene-9,10-dione
1,3-dibromoanthracene-9,10-dione structure
|
Common Name | 1,3-dibromoanthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 602-72-2 | Molecular Weight | 366.00400 | |
| Density | 1.911g/cm3 | Boiling Point | 491.8ºC at 760 mmHg | |
| Molecular Formula | C14H6Br2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.2ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,3-Dibromoanthraquinone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.911g/cm3 |
|---|---|
| Boiling Point | 491.8ºC at 760 mmHg |
| Molecular Formula | C14H6Br2O2 |
| Molecular Weight | 366.00400 |
| Flash Point | 172.2ºC |
| Exact Mass | 363.87300 |
| PSA | 34.14000 |
| LogP | 3.98700 |
| Index of Refraction | 1.7 |
| InChIKey | KXEWYGIZIZYGDL-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)c2c(Br)cc(Br)cc21 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:518-83-2
CAS#:6375-37-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,3-Dibrom-anthrachinon |
| 1,3-Dibromo-4,4-dimethyl-2-pentanone |
| 1,3-dibromo-anthraquinone |
| 1,3-Dibrom-4,4-dimethyl-2-pentanon |
| 1,3-dibromo-4,4-dimethyl-pentan-2-one |
| 1,3-Dibrom-4,4-dimethylpentan-2-on |
| 2,4-Dibromanthrachinon |
| 1,3-Dibrom-4,4-dimethyl-pentanon-2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 1,3-Dibromoanthraquinone? |
| A: Polar surface area (PSA) of 1,3-Dibromoanthraquinone is 34.14000. |
| Q: What English synonyms does 1,3-Dibromoanthraquinone have? |
| A: English synonyms of 1,3-Dibromoanthraquinone: 1,3-Dibrom-anthrachinon, 1,3-Dibromo-4,4-dimethyl-2-pentanone, 1,3-dibromo-anthraquinone, 1,3-Dibrom-4,4-dimethyl-2-pentanon, 1,3-dibromo-4,4-dimethyl-pentan-2-one, 1,3-Dibrom-4,4-dimethylpentan-2-on, 2,4-Dibromanthrachinon, 1,3-Dibrom-4,4-dimethyl-pentanon-2. |
| Q: What are the downstream products of 1,3-Dibromoanthraquinone? |
| A: Related downstream products(CAS) of 1,3-Dibromoanthraquinone: 518-83-2;6375-37-7. |
| Q: What is the molecular formula of 1,3-Dibromoanthraquinone? |
| A: Molecular formula of 1,3-Dibromoanthraquinone is C14H6Br2O2. |
| Q: What is the CAS number of 1,3-Dibromoanthraquinone? |
| A: CAS number of 1,3-Dibromoanthraquinone is 602-72-2. |
| Q: What is the InChIKey of 1,3-Dibromoanthraquinone? |
| A: InChIKey of 1,3-Dibromoanthraquinone is KXEWYGIZIZYGDL-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 602-72-2? |
| A: Chinese name of 602-72-2 is 602-72-2. |
| Q: What is the boiling point of 1,3-Dibromoanthraquinone? |
| A: Boiling point of 1,3-Dibromoanthraquinone is 491.8ºC at 760 mmHg. |
| Q: What is the LogP of 1,3-Dibromoanthraquinone? |
| A: LogP of 1,3-Dibromoanthraquinone is 3.98700. |
| Q: What is the English name of 1,3-Dibromoanthraquinone? |
| A: The English name of 1,3-Dibromoanthraquinone is 1,3-Dibromoanthraquinone. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |