1-amino-3-bromoanthracene-9,10-dione
1-amino-3-bromoanthracene-9,10-dione structure
|
Common Name | 1-amino-3-bromoanthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 6375-37-7 | Molecular Weight | 302.12300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H8BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-amino-3-bromoanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H8BrNO2 |
|---|---|
| Molecular Weight | 302.12300 |
| Exact Mass | 300.97400 |
| PSA | 60.16000 |
| LogP | 3.38790 |
| InChIKey | RPNOZQWUARYYRS-UHFFFAOYSA-N |
| SMILES | Nc1cc(Br)cc2c1C(=O)c1ccccc1C2=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1-amino-3-bromo... CAS#:6375-37-7 |
| Literature: Ullmann,F.; Eiser Chemische Berichte, 1916 , vol. 49, p. 2165 |
|
~%
1-amino-3-bromo... CAS#:6375-37-7 |
| Literature: I.G. Farbenind. Patent: DE534305 , 1927 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 18, p. 1243 |
|
~%
1-amino-3-bromo... CAS#:6375-37-7 |
| Literature: Ullmann,F.; Eiser Chemische Berichte, 1916 , vol. 49, p. 2165 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 9,10-Anthracenedione,1-amino-3-bromo |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1-amino-3-bromoanthracene-9,10-dione? |
| A: Molecular weight of 1-amino-3-bromoanthracene-9,10-dione is 302.12300. |
| Q: What is the English name of 1-amino-3-bromoanthracene-9,10-dione? |
| A: The English name of 1-amino-3-bromoanthracene-9,10-dione is 1-amino-3-bromoanthracene-9,10-dione. |
| Q: What is the CAS number of 1-amino-3-bromoanthracene-9,10-dione? |
| A: CAS number of 1-amino-3-bromoanthracene-9,10-dione is 6375-37-7. |
| Q: What English synonyms does 1-amino-3-bromoanthracene-9,10-dione have? |
| A: English synonyms of 1-amino-3-bromoanthracene-9,10-dione: 9,10-Anthracenedione,1-amino-3-bromo. |
| Q: What is the SMILES notation of 1-amino-3-bromoanthracene-9,10-dione? |
| A: SMILES notation of 1-amino-3-bromoanthracene-9,10-dione is Nc1cc(Br)cc2c1C(=O)c1ccccc1C2=O. |
| Q: What is the polar surface area (PSA) of 1-amino-3-bromoanthracene-9,10-dione? |
| A: Polar surface area (PSA) of 1-amino-3-bromoanthracene-9,10-dione is 60.16000. |
| Q: What is the InChIKey of 1-amino-3-bromoanthracene-9,10-dione? |
| A: InChIKey of 1-amino-3-bromoanthracene-9,10-dione is RPNOZQWUARYYRS-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 6375-37-7? |
| A: Chinese name of 6375-37-7 is 6375-37-7. |
| Q: What is the molecular formula of 1-amino-3-bromoanthracene-9,10-dione? |
| A: Molecular formula of 1-amino-3-bromoanthracene-9,10-dione is C14H8BrNO2. |
| Q: What is the LogP of 1-amino-3-bromoanthracene-9,10-dione? |
| A: LogP of 1-amino-3-bromoanthracene-9,10-dione is 3.38790. |