2a,4a,6a-Trimethylhexahydro-2H-1,4-dioxa-6b-azacyclopenta[cd]pentalene structure
|
Common Name | 2a,4a,6a-Trimethylhexahydro-2H-1,4-dioxa-6b-azacyclopenta[cd]pentalene | ||
|---|---|---|---|---|
| CAS Number | 60204-70-8 | Molecular Weight | 183.24700 | |
| Density | 1.15g/cm3 | Boiling Point | 225.8ºC at 760 mmHg | |
| Molecular Formula | C10H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 75.8ºC | |
| Name | 2a,4a,6a-trimethyl-hexahydro-1,4-dioxa-6b-aza-cyclopenta[cd]pentalene |
|---|
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 225.8ºC at 760 mmHg |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.24700 |
| Flash Point | 75.8ºC |
| Exact Mass | 183.12600 |
| PSA | 21.70000 |
| LogP | 1.27160 |
| Index of Refraction | 1.54 |
| InChIKey | KKVDKBQPJBNAFI-UHFFFAOYSA-N |
| SMILES | CC12COC3(C)CCC(C)(OC1)N23 |
|
~%
2a,4a,6a-Trimet... CAS#:60204-70-8 |
| Literature: Broadbent,H.S. et al. Journal of Heterocyclic Chemistry, 1976 , vol. 13, p. 337 - 348 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |