2-(N-Methylchloroacetyzamine)-5-chlorobenzophenone structure
|
Common Name | 2-(N-Methylchloroacetyzamine)-5-chlorobenzophenone | ||
|---|---|---|---|---|
| CAS Number | 6021-21-2 | Molecular Weight | 322.18600 | |
| Density | 1.328g/cm3 | Boiling Point | 509.3ºC at 760 mmHg | |
| Molecular Formula | C16H13Cl2NO2 | Melting Point | 122-124℃ | |
| MSDS | N/A | Flash Point | 261.8ºC | |
| Name | N-(2-benzoyl-4-chlorophenyl)-2-chloro-N-methylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.328g/cm3 |
|---|---|
| Boiling Point | 509.3ºC at 760 mmHg |
| Melting Point | 122-124℃ |
| Molecular Formula | C16H13Cl2NO2 |
| Molecular Weight | 322.18600 |
| Flash Point | 261.8ºC |
| Exact Mass | 321.03200 |
| PSA | 37.38000 |
| LogP | 3.77260 |
| Index of Refraction | 1.616 |
| InChIKey | DSAWUUVGNZAARH-UHFFFAOYSA-N |
| SMILES | CN(C(=O)CCl)c1ccc(Cl)cc1C(=O)c1ccccc1 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2924299090 |
|
~91%
2-(N-Methylchlo... CAS#:6021-21-2 |
| Literature: Clarke, George M.; Lee, J. Barry; Swinbourne, Frederick J.; Williamson, Basil Journal of Chemical Research, Miniprint, 1980 , # 12 p. 4745 - 4761 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-(N-METHYLCHLOROACETYZAMINE)-5-CHLOROBENZOPHENONE,ENTERPRISE STANDARD |
| 2-<Chloracetyl-N-methylamino>-5-chlor-benzophenon |
| 5-chloro-2-(2-chloro-N-methylacetamido)benzophenone |
| 2-(2-chloro-N-methyl-acetamido)-5-chlorobenzophenone |
| 2-chloro-N-[4-chloro-2-(phenylcarbonyl)phenyl]-N-methylacetamide |
| N-methyl 2'-benzoyl-2,4'-dichloroacetanilide |