octyl 2-(diethylamino)-2-oxoacetate structure
|
Common Name | octyl 2-(diethylamino)-2-oxoacetate | ||
|---|---|---|---|---|
| CAS Number | 60254-67-3 | Molecular Weight | 257.36900 | |
| Density | 0.962g/cm3 | Boiling Point | 327.1ºC at 760 mmHg | |
| Molecular Formula | C14H27NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 151.6ºC | |
| Name | octyl 2-(diethylamino)-2-oxoacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.962g/cm3 |
|---|---|
| Boiling Point | 327.1ºC at 760 mmHg |
| Molecular Formula | C14H27NO3 |
| Molecular Weight | 257.36900 |
| Flash Point | 151.6ºC |
| Exact Mass | 257.19900 |
| PSA | 46.61000 |
| LogP | 2.75850 |
| Index of Refraction | 1.453 |
| InChIKey | XJSRRFWDVFYAIG-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOC(=O)C(=O)N(CC)CC |
|
~%
octyl 2-(diethy... CAS#:60254-67-3 |
| Literature: Naumov,Yu.A. et al. Journal of Organic Chemistry USSR (English Translation), 1976 , vol. 12, p. 2428 - 2432 Zhurnal Organicheskoi Khimii, 1976 , vol. 12, p. 2507 - 2511 |
| N,N-Diethyloxaminsaeure-octylester |
| Acetic acid,(diethylamino)oxo-,octyl ester |
| N,N-Diethyloxamsaeure-octylester |
| Octyl N,N-diethyloxamate |
| Octyl (diethylamino)oxoacetate |