nonyl 2-(diethylamino)-2-oxoacetate structure
|
Common Name | nonyl 2-(diethylamino)-2-oxoacetate | ||
|---|---|---|---|---|
| CAS Number | 60254-68-4 | Molecular Weight | 271.39600 | |
| Density | 0.955g/cm3 | Boiling Point | 343.2ºC at 760 mmHg | |
| Molecular Formula | C15H29NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.3ºC | |
| Name | nonyl 2-(diethylamino)-2-oxoacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.955g/cm3 |
|---|---|
| Boiling Point | 343.2ºC at 760 mmHg |
| Molecular Formula | C15H29NO3 |
| Molecular Weight | 271.39600 |
| Flash Point | 161.3ºC |
| Exact Mass | 271.21500 |
| PSA | 46.61000 |
| LogP | 3.14860 |
| Index of Refraction | 1.455 |
| InChIKey | ZXCUJUPZAWBDTD-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCOC(=O)C(=O)N(CC)CC |
|
~%
nonyl 2-(diethy... CAS#:60254-68-4 |
| Literature: Naumov,Yu.A. et al. Journal of Organic Chemistry USSR (English Translation), 1976 , vol. 12, p. 2428 - 2432 Zhurnal Organicheskoi Khimii, 1976 , vol. 12, p. 2507 - 2511 |
| N,N-Diethyloxaminsaeure-nonylester |
| Nonyl N,N-diethyloxamate |