3-(2-thienyl)-1-(p-tolyl)-prop-2-en-1-one
3-(2-thienyl)-1-(p-tolyl)-prop-2-en-1-one structure
|
Common Name | 3-(2-thienyl)-1-(p-tolyl)-prop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 6028-89-3 | Molecular Weight | 228.30900 | |
| Density | 1.167g/cm3 | Boiling Point | 381.5ºC at 760 mmHg | |
| Molecular Formula | C14H12OS | Melting Point | 75 °C | |
| MSDS | N/A | Flash Point | 184.5ºC | |
Summary: 3-(2-thienyl)-1-(p-tolyl)-prop-2-en-1-one (CAS number: 6028-89-3, molecular formula: C14H12OS, molecular weight: 228.31) is an organic compound for research use only.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(2-thienyl)-1-(p-tolyl)-prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.167g/cm3 |
|---|---|
| Boiling Point | 381.5ºC at 760 mmHg |
| Melting Point | 75 °C |
| Molecular Formula | C14H12OS |
| Molecular Weight | 228.30900 |
| Flash Point | 184.5ºC |
| Exact Mass | 228.06100 |
| PSA | 45.31000 |
| LogP | 3.95260 |
| Index of Refraction | 1.638 |
| InChIKey | OUDDTWPBSXBJOY-CMDGGOBGSA-N |
| SMILES | Cc1ccc(C(=O)C=Cc2cccs2)cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xn |
|---|---|
| Risk Phrases | R22:Harmful if swallowed. |
| WGK Germany | 1 |
| RTECS | UP8225000 |
| HS Code | 29322980 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~96%
3-(2-thienyl)-1... CAS#:6028-89-3 |
| Literature: Zheng, Chang-Ji; Jiang, Sheng-Ming; Chen, Zhen-Hua; Ye, Bai-Jun; Piao, Hu-Ri Archiv der Pharmazie, 2011 , vol. 344, # 10 p. 689 - 695 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-(4-METHYLPHENYL)-3-(THIEN-2-YL)PROP-2-EN-1-ONE |
| 3-(2-THIENYL)-1-(P-TOLYL)-2-PROPEN-1-ONE |
| 3-thiophen-2-yl-1-p-tolyl-propenone |
| 1-(4-methylphenyl)-3-(2-thienyl)prop-2-en-1-one |
| (E)-3-(thiophen-2-yl)-1-p-tolylprop-2-en-1-one |
| (E)-3-thiophen-2-yl-1-p-tolylpropenone |
| 1-(4-METHYLPHENYL)-3-(2-THIENYL)-2-PROPEN-1-ONE |
| (2E)-1-(4-Methylphenyl)-3-(2-thienyl)-2-propen-1-one |
| 3-(Furan-2''-yl)-1-p-tolylpropenone |
| (E)-3-(2-thienyl)-1-(p-tolyl)-2-propen-1-one |
| MFCD00022532 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3-(2-thienyl)-1-(p-tolyl)-prop-2-en-1-one? |
| A: CAS number of 3-(2-thienyl)-1-(p-tolyl)-prop-2-en-1-one is 6028-89-3. |
| Q: What is the polar surface area (PSA) of 3-(2-thienyl)-1-(p-tolyl)-prop-2-en-1-one? |
| A: Polar surface area (PSA) of 3-(2-thienyl)-1-(p-tolyl)-prop-2-en-1-one is 45.31000. |
| Q: What is the SMILES notation of 3-(2-thienyl)-1-(p-tolyl)-prop-2-en-1-one? |
| A: SMILES notation of 3-(2-thienyl)-1-(p-tolyl)-prop-2-en-1-one is Cc1ccc(C(=O)C=Cc2cccs2)cc1. |
| Q: What is the InChIKey of 3-(2-thienyl)-1-(p-tolyl)-prop-2-en-1-one? |
| A: InChIKey of 3-(2-thienyl)-1-(p-tolyl)-prop-2-en-1-one is OUDDTWPBSXBJOY-CMDGGOBGSA-N. |
| Q: What is the English name of 3-(2-thienyl)-1-(p-tolyl)-prop-2-en-1-one? |
| A: The English name of 3-(2-thienyl)-1-(p-tolyl)-prop-2-en-1-one is 3-(2-thienyl)-1-(p-tolyl)-prop-2-en-1-one. |
| Q: What is the molecular weight of 3-(2-thienyl)-1-(p-tolyl)-prop-2-en-1-one? |
| A: Molecular weight of 3-(2-thienyl)-1-(p-tolyl)-prop-2-en-1-one is 228.30900. |
| Q: What are the upstream materials of 3-(2-thienyl)-1-(p-tolyl)-prop-2-en-1-one? |
| A: Related upstream materials(CAS) of 3-(2-thienyl)-1-(p-tolyl)-prop-2-en-1-one: 98-03-3;122-00-9. |
| Q: What is the boiling point of 3-(2-thienyl)-1-(p-tolyl)-prop-2-en-1-one? |
| A: Boiling point of 3-(2-thienyl)-1-(p-tolyl)-prop-2-en-1-one is 381.5ºC at 760 mmHg. |
| Q: What is the LogP of 3-(2-thienyl)-1-(p-tolyl)-prop-2-en-1-one? |
| A: LogP of 3-(2-thienyl)-1-(p-tolyl)-prop-2-en-1-one is 3.95260. |
| Q: What is the molecular formula of 3-(2-thienyl)-1-(p-tolyl)-prop-2-en-1-one? |
| A: Molecular formula of 3-(2-thienyl)-1-(p-tolyl)-prop-2-en-1-one is C14H12OS. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |