(4-Methylphenyl)-triphenylphosphonium bromide structure
|
Common Name | (4-Methylphenyl)-triphenylphosphonium bromide | ||
|---|---|---|---|---|
| CAS Number | 6031-78-3 | Molecular Weight | 433.32000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H22BrP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-methylphenyl)-triphenylphosphanium,bromide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C25H22BrP |
|---|---|
| Molecular Weight | 433.32000 |
| Exact Mass | 432.06400 |
| PSA | 13.59000 |
| LogP | 1.61840 |
| InChIKey | YDIADJZNZNNADU-UHFFFAOYSA-M |
| SMILES | Cc1ccc([P+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.[Br-] |
| HS Code | 2931900090 |
|---|
|
~92%
(4-Methylphenyl... CAS#:6031-78-3 |
| Literature: Marcoux, David; Charette, Andre B. Journal of Organic Chemistry, 2008 , vol. 73, # 2 p. 590 - 593 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Triphenyl-p-tolyl-phosphoniumbromid |
| p-Tolyl-triphenylphosphoniumbromid |