methylarbutoside structure
|
Common Name | methylarbutoside | ||
|---|---|---|---|---|
| CAS Number | 6032-32-2 | Molecular Weight | 286.278 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 519.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C13H18O7 | Melting Point | 176ºC | |
| MSDS | N/A | Flash Point | 267.7±30.1 °C | |
Use of methylarbutosideMethylarbutin is an ice recrystallization inhibitor (IRI). |
| Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(4-methoxyphenoxy)oxane-3,4,5-triol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 519.0±50.0 °C at 760 mmHg |
| Melting Point | 176ºC |
| Molecular Formula | C13H18O7 |
| Molecular Weight | 286.278 |
| Flash Point | 267.7±30.1 °C |
| Exact Mass | 286.105255 |
| PSA | 108.61000 |
| LogP | -0.73 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.600 |
| InChIKey | SIXFVXJMCGPTRB-UJPOAAIJSA-N |
| SMILES | COc1ccc(OC2OC(CO)C(O)C(O)C2O)cc1 |
| methylarbutoside |
| p-Methoxyphenyl b-D-glucoside |
| 4-Methoxyphenylglucoside |
| 4-Methoxyphenyl β-D-glucopyranoside |
| Methylarbutin |
| β-D-Glucopyranoside, 4-methoxyphenyl |
| 4-Methoxyphenyl b-D-glucopyranoside |
| 4-Methoxyphenyl beta-D-glucopyranoside |
| 4-Methoxyphenyl-b-D-glucopyranoside |
| p-Methoxyphenyl β-D-glucopyranoside |