(3a,5b,7a,12a)-3,12-dihydroxy-7-(sulfooxy)-Cholan-24-oic acid structure
|
Common Name | (3a,5b,7a,12a)-3,12-dihydroxy-7-(sulfooxy)-Cholan-24-oic acid | ||
|---|---|---|---|---|
| CAS Number | 60320-05-0 | Molecular Weight | 488.635 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C24H40O8S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (3a,5b,7a,12a)-3,12-dihydroxy-7-(sulfooxy)-Cholan-24-oic acidCholic acid 7-sulfate (7-Sulfocholic acid), a metabolite of Cholic acid, is a Takeda G-protein receptor 5 (TGR5) agonist. Cholic acid 7-sulfate can increase Tgr5 expression and induce GLP-1 secretion[1]. |
| Name | Cholic Acid 7-sulfate |
|---|---|
| Synonym | More Synonyms |
| Description | Cholic acid 7-sulfate (7-Sulfocholic acid), a metabolite of Cholic acid, is a Takeda G-protein receptor 5 (TGR5) agonist. Cholic acid 7-sulfate can increase Tgr5 expression and induce GLP-1 secretion[1]. |
|---|---|
| Related Catalog | |
| Target |
TGR[1] |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C24H40O8S |
| Molecular Weight | 488.635 |
| Exact Mass | 488.244385 |
| LogP | 2.88 |
| Index of Refraction | 1.582 |
| InChIKey | RRVLNNMINXAIKC-OELDTZBJSA-N |
| SMILES | CC(CCC(=O)O)C1CCC2C3C(OS(=O)(=O)O)CC4CC(O)CCC4(C)C3CC(O)C12C |
| 7-Sulfocholic acid |
| Cholic acid 7-sulfate |
| (3α,5β,7α,12α)-3,12-Dihydroxy-7-(sulfooxy)cholan-24-oic acid |
| (3a,5b,7a,12a)-3,12-Dihydroxy-7-(sulfooxy)-cholan-24-oic acid |
| Cholan-24-oic acid, 3,12-dihydroxy-7-(sulfooxy)-, (3α,5β,7α,12α)- |