Pyrimidine, 4-chloro-6-methoxy-2-methyl-5-nitro
Pyrimidine, 4-chloro-6-methoxy-2-methyl-5-nitro structure
|
Common Name | Pyrimidine, 4-chloro-6-methoxy-2-methyl-5-nitro | ||
|---|---|---|---|---|
| CAS Number | 60331-15-9 | Molecular Weight | 203.58300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H6ClN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-chloro-6-methoxy-2-methyl-5-nitropyrimidine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H6ClN3O3 |
|---|---|
| Molecular Weight | 203.58300 |
| Exact Mass | 203.01000 |
| PSA | 80.83000 |
| LogP | 1.87840 |
| InChIKey | XENBELIGWDKZOP-UHFFFAOYSA-N |
| SMILES | COc1nc(C)nc(Cl)c1[N+](=O)[O-] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
Pyrimidine, 4-c... CAS#:60331-15-9 |
| Literature: Urban; Schnider Helvetica Chimica Acta, 1958 , vol. 41, p. 1806,1812 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-Chlor-6-methoxy-2-methyl-5-nitro-pyrimidin |
| Pyrimidine,4-chloro-6-methoxy-2-methyl-5-nitro |
| 2-methyl-4-methoxy-5-nitro-6-chloro-pyrimidine |
| 4-chloro-6-methoxy-2-methyl-5-nitro-pyrimidine |
| 6-chloro-4-methoxy-2-methyl-5-nitro-pyrimidine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 4-chloro-6-methoxy-2-methyl-5-nitropyrimidine? |
| A: InChIKey of 4-chloro-6-methoxy-2-methyl-5-nitropyrimidine is XENBELIGWDKZOP-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4-chloro-6-methoxy-2-methyl-5-nitropyrimidine? |
| A: Molecular weight of 4-chloro-6-methoxy-2-methyl-5-nitropyrimidine is 203.58300. |
| Q: What is the polar surface area (PSA) of 4-chloro-6-methoxy-2-methyl-5-nitropyrimidine? |
| A: Polar surface area (PSA) of 4-chloro-6-methoxy-2-methyl-5-nitropyrimidine is 80.83000. |
| Q: What is the CAS number of 4-chloro-6-methoxy-2-methyl-5-nitropyrimidine? |
| A: CAS number of 4-chloro-6-methoxy-2-methyl-5-nitropyrimidine is 60331-15-9. |
| Q: What is the SMILES notation of 4-chloro-6-methoxy-2-methyl-5-nitropyrimidine? |
| A: SMILES notation of 4-chloro-6-methoxy-2-methyl-5-nitropyrimidine is COc1nc(C)nc(Cl)c1[N+](=O)[O-]. |
| Q: What English synonyms does 4-chloro-6-methoxy-2-methyl-5-nitropyrimidine have? |
| A: English synonyms of 4-chloro-6-methoxy-2-methyl-5-nitropyrimidine: 4-Chlor-6-methoxy-2-methyl-5-nitro-pyrimidin, Pyrimidine,4-chloro-6-methoxy-2-methyl-5-nitro, 2-methyl-4-methoxy-5-nitro-6-chloro-pyrimidine, 4-chloro-6-methoxy-2-methyl-5-nitro-pyrimidine, 6-chloro-4-methoxy-2-methyl-5-nitro-pyrimidine. |
| Q: What is the molecular formula of 4-chloro-6-methoxy-2-methyl-5-nitropyrimidine? |
| A: Molecular formula of 4-chloro-6-methoxy-2-methyl-5-nitropyrimidine is C6H6ClN3O3. |
| Q: What is the English name of 4-chloro-6-methoxy-2-methyl-5-nitropyrimidine? |
| A: The English name of 4-chloro-6-methoxy-2-methyl-5-nitropyrimidine is 4-chloro-6-methoxy-2-methyl-5-nitropyrimidine. |
| Q: What is the LogP of 4-chloro-6-methoxy-2-methyl-5-nitropyrimidine? |
| A: LogP of 4-chloro-6-methoxy-2-methyl-5-nitropyrimidine is 1.87840. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |