4,6-Dichloro-2-methyl-5-nitropyrimidine structure
|
Common Name | 4,6-Dichloro-2-methyl-5-nitropyrimidine | ||
|---|---|---|---|---|
| CAS Number | 13162-43-1 | Molecular Weight | 208.002 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 310.4±37.0 °C at 760 mmHg | |
| Molecular Formula | C5H3Cl2N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.5±26.5 °C | |
| Name | 4,6-Dichloro-2-methyl-5-nitropyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 310.4±37.0 °C at 760 mmHg |
| Molecular Formula | C5H3Cl2N3O2 |
| Molecular Weight | 208.002 |
| Flash Point | 141.5±26.5 °C |
| Exact Mass | 206.960236 |
| PSA | 71.60000 |
| LogP | 1.48 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.597 |
| InChIKey | OPXGPTXSLFZVCA-UHFFFAOYSA-N |
| SMILES | Cc1nc(Cl)c([N+](=O)[O-])c(Cl)n1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933599090 |
|
~78%
4,6-Dichloro-2-... CAS#:13162-43-1 |
| Literature: Kowa Company, Ltd. Patent: US6849647 B1, 2005 ; Location in patent: Page/Page column 134 ; |
|
~%
4,6-Dichloro-2-... CAS#:13162-43-1 |
| Literature: Journal of Medicinal Chemistry, , vol. 43, # 22 p. 4288 - 4312 |
|
~%
4,6-Dichloro-2-... CAS#:13162-43-1 |
| Literature: Chemische Berichte, , vol. 71, p. 87,99 |
|
~%
4,6-Dichloro-2-... CAS#:13162-43-1 |
| Literature: Journal of the Chemical Society, , p. 3832,3833 |
|
~%
4,6-Dichloro-2-... CAS#:13162-43-1 |
| Literature: DuPont Pharmaceuticals Company Patent: US6342503 B1, 2002 ; Location in patent: Example 101 ; US 6342503 B1 |
| Precursor 5 | |
|---|---|
| DownStream 9 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,6-Dichloro-2-methyl-5-nitropyrimidine |
| Pyrimidine, 4,6-dichloro-2-methyl-5-nitro- |
| dichloro-2-methyl-5-nitro-pyrimidine |
| 4,6-dichloro-2-methyl-5-nitro-pyrimidine |
| Pyrimidine,4,6-dichloro-2-methyl-5-nitro |
| 2-methyl-5-nitro-4,6-dichloro-pyrimidine |
| 2-methyl-4,6-dichloro-5-nitropyrimidine |
| 4,6-dichlor-2-methyl-5-nitropyrimidin |