2-phenoxyethyl 2-propan-2-yloxyacetate
2-phenoxyethyl 2-propan-2-yloxyacetate structure
|
Common Name | 2-phenoxyethyl 2-propan-2-yloxyacetate | ||
|---|---|---|---|---|
| CAS Number | 60359-63-9 | Molecular Weight | 238.28000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-phenoxyethyl 2-propan-2-yloxyacetate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H18O4 |
|---|---|
| Molecular Weight | 238.28000 |
| Exact Mass | 238.12100 |
| PSA | 44.76000 |
| LogP | 2.03360 |
| InChIKey | UDYRZMYDYBQKNC-UHFFFAOYSA-N |
| SMILES | CC(C)OCC(=O)OCCOc1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-phenoxyethyl ... CAS#:60359-63-9 |
| Literature: Nissan Chem. Patent: FR2279333DE2519433 , 19761976 ; Chem.Abstr., 1976 , vol. 85, # 123623 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Acetic acid,(1-methylethoxy)-,2-phenoxyethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 2-phenoxyethyl 2-propan-2-yloxyacetate? |
| A: Polar surface area (PSA) of 2-phenoxyethyl 2-propan-2-yloxyacetate is 44.76000. |
| Q: What is the SMILES notation of 2-phenoxyethyl 2-propan-2-yloxyacetate? |
| A: SMILES notation of 2-phenoxyethyl 2-propan-2-yloxyacetate is CC(C)OCC(=O)OCCOc1ccccc1. |
| Q: What is the Chinese name of 60359-63-9? |
| A: Chinese name of 60359-63-9 is 60359-63-9. |
| Q: What is the molecular weight of 2-phenoxyethyl 2-propan-2-yloxyacetate? |
| A: Molecular weight of 2-phenoxyethyl 2-propan-2-yloxyacetate is 238.28000. |
| Q: What is the CAS number of 2-phenoxyethyl 2-propan-2-yloxyacetate? |
| A: CAS number of 2-phenoxyethyl 2-propan-2-yloxyacetate is 60359-63-9. |
| Q: What is the molecular formula of 2-phenoxyethyl 2-propan-2-yloxyacetate? |
| A: Molecular formula of 2-phenoxyethyl 2-propan-2-yloxyacetate is C13H18O4. |
| Q: What is the LogP of 2-phenoxyethyl 2-propan-2-yloxyacetate? |
| A: LogP of 2-phenoxyethyl 2-propan-2-yloxyacetate is 2.03360. |
| Q: What English synonyms does 2-phenoxyethyl 2-propan-2-yloxyacetate have? |
| A: English synonyms of 2-phenoxyethyl 2-propan-2-yloxyacetate: Acetic acid,(1-methylethoxy)-,2-phenoxyethyl ester. |
| Q: What is the InChIKey of 2-phenoxyethyl 2-propan-2-yloxyacetate? |
| A: InChIKey of 2-phenoxyethyl 2-propan-2-yloxyacetate is UDYRZMYDYBQKNC-UHFFFAOYSA-N. |
| Q: What is the English name of 2-phenoxyethyl 2-propan-2-yloxyacetate? |
| A: The English name of 2-phenoxyethyl 2-propan-2-yloxyacetate is 2-phenoxyethyl 2-propan-2-yloxyacetate. |