4-chloro-3-(dimethylaminomethylideneamino)sulfonylbenzoic acid
4-chloro-3-(dimethylaminomethylideneamino)sulfonylbenzoic acid structure
|
Common Name | 4-chloro-3-(dimethylaminomethylideneamino)sulfonylbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 60376-72-9 | Molecular Weight | 290.72300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11ClN2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-chloro-3-(dimethylaminomethylideneamino)sulfonylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H11ClN2O4S |
|---|---|
| Molecular Weight | 290.72300 |
| Exact Mass | 290.01300 |
| PSA | 95.42000 |
| LogP | 2.39760 |
| InChIKey | UNBFTTUFKXTLKP-UHFFFAOYSA-N |
| SMILES | CN(C)C=NS(=O)(=O)c1cc(C(=O)O)ccc1Cl |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
4-chloro-3-(dim... CAS#:60376-72-9 |
| Literature: Hoechst Aktiengesellschaft Patent: US4010273 A1, 1977 ; |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-chloro-5-N,N-dimethylaminomethyleneaminosulphonylbenzoic acid |
| Benzoic acid,4-chloro-3-[[[(dimethylamino)methylene]amino]sulfonyl] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4-chloro-3-(dimethylaminomethylideneamino)sulfonylbenzoic acid? |
| A: The English name of 4-chloro-3-(dimethylaminomethylideneamino)sulfonylbenzoic acid is 4-chloro-3-(dimethylaminomethylideneamino)sulfonylbenzoic acid. |
| Q: What English synonyms does 4-chloro-3-(dimethylaminomethylideneamino)sulfonylbenzoic acid have? |
| A: English synonyms of 4-chloro-3-(dimethylaminomethylideneamino)sulfonylbenzoic acid: 4-chloro-5-N,N-dimethylaminomethyleneaminosulphonylbenzoic acid, Benzoic acid,4-chloro-3-[[[(dimethylamino)methylene]amino]sulfonyl]. |
| Q: What is the LogP of 4-chloro-3-(dimethylaminomethylideneamino)sulfonylbenzoic acid? |
| A: LogP of 4-chloro-3-(dimethylaminomethylideneamino)sulfonylbenzoic acid is 2.39760. |
| Q: What is the Chinese name of 60376-72-9? |
| A: Chinese name of 60376-72-9 is 60376-72-9. |
| Q: What is the molecular formula of 4-chloro-3-(dimethylaminomethylideneamino)sulfonylbenzoic acid? |
| A: Molecular formula of 4-chloro-3-(dimethylaminomethylideneamino)sulfonylbenzoic acid is C10H11ClN2O4S. |
| Q: What is the polar surface area (PSA) of 4-chloro-3-(dimethylaminomethylideneamino)sulfonylbenzoic acid? |
| A: Polar surface area (PSA) of 4-chloro-3-(dimethylaminomethylideneamino)sulfonylbenzoic acid is 95.42000. |
| Q: What is the SMILES notation of 4-chloro-3-(dimethylaminomethylideneamino)sulfonylbenzoic acid? |
| A: SMILES notation of 4-chloro-3-(dimethylaminomethylideneamino)sulfonylbenzoic acid is CN(C)C=NS(=O)(=O)c1cc(C(=O)O)ccc1Cl. |
| Q: What is the InChIKey of 4-chloro-3-(dimethylaminomethylideneamino)sulfonylbenzoic acid? |
| A: InChIKey of 4-chloro-3-(dimethylaminomethylideneamino)sulfonylbenzoic acid is UNBFTTUFKXTLKP-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4-chloro-3-(dimethylaminomethylideneamino)sulfonylbenzoic acid? |
| A: Molecular weight of 4-chloro-3-(dimethylaminomethylideneamino)sulfonylbenzoic acid is 290.72300. |
| Q: What is the CAS number of 4-chloro-3-(dimethylaminomethylideneamino)sulfonylbenzoic acid? |
| A: CAS number of 4-chloro-3-(dimethylaminomethylideneamino)sulfonylbenzoic acid is 60376-72-9. |