Boc-Phe-O-COO-isoBu
Boc-Phe-O-COO-isoBu structure
|
Common Name | Boc-Phe-O-COO-isoBu | ||
|---|---|---|---|---|
| CAS Number | 60398-40-5 | Molecular Weight | 365.42100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H27NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Boc-Phe-O-COO-isoBu |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H27NO6 |
|---|---|
| Molecular Weight | 365.42100 |
| Exact Mass | 365.18400 |
| PSA | 90.93000 |
| LogP | 3.84910 |
| InChIKey | KKYMADBQSKHLDY-HNNXBMFYSA-N |
| SMILES | CC(C)COC(=O)OC(=O)C(Cc1ccccc1)NC(=O)OC(C)(C)C |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:150935-37-8
CAS#:115313-19-4This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Boc-L-Phe-DL-Gly(OMe)-OMe |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does Boc-Phe-O-COO-isoBu have? |
| A: English synonyms of Boc-Phe-O-COO-isoBu: Boc-L-Phe-DL-Gly(OMe)-OMe. |
| Q: What is the molecular weight of Boc-Phe-O-COO-isoBu? |
| A: Molecular weight of Boc-Phe-O-COO-isoBu is 365.42100. |
| Q: What is the CAS number of Boc-Phe-O-COO-isoBu? |
| A: CAS number of Boc-Phe-O-COO-isoBu is 60398-40-5. |
| Q: What are the downstream products of Boc-Phe-O-COO-isoBu? |
| A: Related downstream products(CAS) of Boc-Phe-O-COO-isoBu: 150935-37-8;115313-19-4. |
| Q: What is the English name of Boc-Phe-O-COO-isoBu? |
| A: The English name of Boc-Phe-O-COO-isoBu is Boc-Phe-O-COO-isoBu. |
| Q: What is the InChIKey of Boc-Phe-O-COO-isoBu? |
| A: InChIKey of Boc-Phe-O-COO-isoBu is KKYMADBQSKHLDY-HNNXBMFYSA-N. |
| Q: What is the Chinese name of 60398-40-5? |
| A: Chinese name of 60398-40-5 is 60398-40-5. |
| Q: What is the molecular formula of Boc-Phe-O-COO-isoBu? |
| A: Molecular formula of Boc-Phe-O-COO-isoBu is C19H27NO6. |
| Q: What is the LogP of Boc-Phe-O-COO-isoBu? |
| A: LogP of Boc-Phe-O-COO-isoBu is 3.84910. |
| Q: What is the SMILES notation of Boc-Phe-O-COO-isoBu? |
| A: SMILES notation of Boc-Phe-O-COO-isoBu is CC(C)COC(=O)OC(=O)C(Cc1ccccc1)NC(=O)OC(C)(C)C. |