(R)-TERT-BUTYL (4-CHLORO-3-OXO-1-PHENYLBUTAN-2-YL)CARBAMATE structure
|
Common Name | (R)-TERT-BUTYL (4-CHLORO-3-OXO-1-PHENYLBUTAN-2-YL)CARBAMATE | ||
|---|---|---|---|---|
| CAS Number | 150935-37-8 | Molecular Weight | 297.777 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 423.9±40.0 °C at 760 mmHg | |
| Molecular Formula | C15H20ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.2±27.3 °C | |
| Name | tert-butyl N-[(2R)-4-chloro-3-oxo-1-phenylbutan-2-yl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 423.9±40.0 °C at 760 mmHg |
| Molecular Formula | C15H20ClNO3 |
| Molecular Weight | 297.777 |
| Flash Point | 210.2±27.3 °C |
| Exact Mass | 297.113159 |
| PSA | 55.40000 |
| LogP | 3.66 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.517 |
| InChIKey | JAKDNFBATYIEIE-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccccc1)C(=O)CCl |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Methyl-2-propanyl [(2R)-4-chloro-3-oxo-1-phenyl-2-butanyl]carbamate |
| tert-Butyl [(2R)-4-chloro-3-oxo-1-phenylbutan-2-yl]carbamate |
| Carbamic acid, N-[(1R)-3-chloro-2-oxo-1-(phenylmethyl)propyl]-, 1,1-dimethylethyl ester |
| Boc-D-Phechloromethylketone |