6.beta.,17.alpha.-Dihydroxyprogesterone
6.beta.,17.alpha.-Dihydroxyprogesterone structure
|
Common Name | 6.beta.,17.alpha.-Dihydroxyprogesterone | ||
|---|---|---|---|---|
| CAS Number | 604-03-5 | Molecular Weight | 346.46100 | |
| Density | 1.21g/cm3 | Boiling Point | 527.4ºC at 760 mmHg | |
| Molecular Formula | C21H30O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 286.8ºC | |
Summary: 6.β.,17.α.-Dihydroxyprogesterone, Chinese name 6.β.,17.α.-二羟基孕酮, CAS number 604-03-5, molecular formula C21H30O4, molecular weight 346.46100. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6.β.,17.α.-Dihydroxyprogesterone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 527.4ºC at 760 mmHg |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.46100 |
| Flash Point | 286.8ºC |
| Exact Mass | 346.21400 |
| PSA | 74.60000 |
| LogP | 2.80920 |
| Index of Refraction | 1.576 |
| InChIKey | BDQPONLPDKZVNG-SJIZYOMUSA-N |
| SMILES | CC(=O)C1(O)CCC2C3CC(O)C4=CC(=O)CCC4(C)C3CCC21C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 7 | |
|---|---|
| DownStream 0 | |
CAS#:64026-12-6
CAS#:57-83-0
CAS#:68-96-2
CAS#:387-79-1
CAS#:32603-87-5
CAS#:3517-38-2
CAS#:2723-17-3This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 6.β.,17.α.-Dihydroxyprogesterone? |
| A: Polar surface area (PSA) of 6.β.,17.α.-Dihydroxyprogesterone is 74.60000. |
| Q: What is the molecular weight of 6.β.,17.α.-Dihydroxyprogesterone? |
| A: Molecular weight of 6.β.,17.α.-Dihydroxyprogesterone is 346.46100. |
| Q: What is the Chinese name of 604-03-5? |
| A: Chinese name of 604-03-5 is 604-03-5. |
| Q: What is the English name of 6.β.,17.α.-Dihydroxyprogesterone? |
| A: The English name of 6.β.,17.α.-Dihydroxyprogesterone is 6.β.,17.α.-Dihydroxyprogesterone. |
| Q: What is the LogP of 6.β.,17.α.-Dihydroxyprogesterone? |
| A: LogP of 6.β.,17.α.-Dihydroxyprogesterone is 2.80920. |
| Q: What is the InChIKey of 6.β.,17.α.-Dihydroxyprogesterone? |
| A: InChIKey of 6.β.,17.α.-Dihydroxyprogesterone is BDQPONLPDKZVNG-SJIZYOMUSA-N. |
| Q: What is the CAS number of 6.β.,17.α.-Dihydroxyprogesterone? |
| A: CAS number of 6.β.,17.α.-Dihydroxyprogesterone is 604-03-5. |
| Q: What is the boiling point of 6.β.,17.α.-Dihydroxyprogesterone? |
| A: Boiling point of 6.β.,17.α.-Dihydroxyprogesterone is 527.4ºC at 760 mmHg. |
| Q: What is the molecular formula of 6.β.,17.α.-Dihydroxyprogesterone? |
| A: Molecular formula of 6.β.,17.α.-Dihydroxyprogesterone is C21H30O4. |
| Q: What is the SMILES notation of 6.β.,17.α.-Dihydroxyprogesterone? |
| A: SMILES notation of 6.β.,17.α.-Dihydroxyprogesterone is CC(=O)C1(O)CCC2C3CC(O)C4=CC(=O)CCC4(C)C3CCC21C. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |