17α-hydroxyprogesterone structure
|
Common Name | 17α-hydroxyprogesterone | ||
|---|---|---|---|---|
| CAS Number | 68-96-2 | Molecular Weight | 330.461 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 482.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C21H30O3 | Melting Point | 276°C | |
| MSDS | Chinese USA | Flash Point | 260.0±25.2 °C | |
| Symbol |
GHS02, GHS06, GHS08 |
Signal Word | Danger | |
| Name | 17α-hydroxyprogesterone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 482.9±45.0 °C at 760 mmHg |
| Melting Point | 276°C |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.461 |
| Flash Point | 260.0±25.2 °C |
| Exact Mass | 330.219482 |
| PSA | 54.37000 |
| LogP | 2.89 |
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
| Index of Refraction | 1.560 |
| InChIKey | DBPWSSGDRRHUNT-CEGNMAFCSA-N |
| SMILES | CC(=O)C1(O)CCC2C3CCC4=CC(=O)CCC4(C)C3CCC21C |
| Storage condition | -20?C Freezer |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS02, GHS06, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H301 + H311 + H331-H370 |
| Precautionary Statements | P210-P260-P280-P301 + P310-P311 |
| Personal Protective Equipment | Eyeshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T: Toxic; |
| Risk Phrases | 61 |
| Safety Phrases | S53-S22-S36/37/39-S45 |
| RIDADR | 2811.0 |
| WGK Germany | 3 |
| RTECS | TU5060000 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
|
Chemical genetics reveals a complex functional ground state of neural stem cells.
Nat. Chem. Biol. 3(5) , 268-273, (2007) The identification of self-renewing and multipotent neural stem cells (NSCs) in the mammalian brain holds promise for the treatment of neurological diseases and has yielded new insight into brain canc... |
|
|
An updated steroid benchmark set and its application in the discovery of novel nanomolar ligands of sex hormone-binding globulin.
J. Med. Chem. 51 , 2047-56, (2008) A benchmark data set of steroids with known affinity for sex hormone-binding globulin (SHBG) has been widely used to validate popular molecular field-based QSAR techniques. We have expanded the data s... |
|
|
Genetic mapping of targets mediating differential chemical phenotypes in Plasmodium falciparum.
Nat. Chem. Biol. 5 , 765-71, (2009) Studies of gene function and molecular mechanisms in Plasmodium falciparum are hampered by difficulties in characterizing and measuring phenotypic differences between individual parasites. We screened... |
| 17α-Hydroxypregn-4-ene-3,20-dione |
| 17-Hydroxypregn-4-en-3,20-dione |
| MFCD00003659 |
| hydroxyprogesteronum [INN_la] |
| 17-Hydroxypregn-4-ene-3,20-dione |
| 4-Pregnen-17a-ol-3,20-dione |
| 4-Pregnen-17α-ol-3,20-dione |
| 17alpha-hydroxyprogesterone |
| Pregn-4-ene-3,20-dione, 17-hydroxy- |
| 17α-Hydroxyprogesterone |
| Gestageno |
| L E5 B666 OV MUTJ A1 E1 FV1 FQ &&17α |
| EINECS 200-699-4 |
| 17a-Hydroxypregn-4-ene-3,20-dione |
| 17A-hydroxyprogesterone |
| 17-Hydroxyprogesterone |