paramyon
paramyon structure
|
Common Name | paramyon | ||
|---|---|---|---|---|
| CAS Number | 604-92-2 | Molecular Weight | 608.38100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H38I2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | trimethyl-[4-[4-[4-(trimethylazaniumyl)phenyl]hexan-3-yl]phenyl]azanium,diiodide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C24H38I2N2 |
|---|---|
| Molecular Weight | 608.38100 |
| Exact Mass | 608.11200 |
| InChIKey | CLMIEWJBSVHIJU-UHFFFAOYSA-L |
| SMILES | CCC(c1ccc([N+](C)(C)C)cc1)C(CC)c1ccc([N+](C)(C)C)cc1.[I-].[I-] |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Safety Phrases | S61 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
paramyon CAS#:604-92-2 |
| Literature: Torf; Chromow-Borisow Zhurnal Obshchei Khimii, 1954 , vol. 24, p. 2168,2169; engl.Ausg.S.2137,2140 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4,4'-hexane-3,4-diylbis(N,N,N-trimethylanilinium) diiodide |
| meso-Hexa-N-methyl-4,4'-(1,2-diaethyl-aethandiyl)-di-anilinium,Dijodid |
| trimethyl-[4-[4-[4-(trimethylazaniumyl)phenyl]hexan-3-yl]phenyl]azanium diiodide |
| ((1,2-Diethylethylene)di-p-phenylene)bis(trimethylammonium),diiodide |
| Paramyon |
| Benzenamium,4,4'-(1,2-diethyl-1,2-ethanediyl)bis(N,N,N-trimethyl-,diiodide,(R*,S*) |
| Ammonium,((1,2-diethylethylene)di-p-phenylene)bis(trimethyl-,diodide,stereoisomer |
| meso-hexa-N-methyl-4,4'-(1,2-diethyl-ethanediyl)-di-anilinium,diiodide |
| Paramion |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of trimethyl-[4-[4-[4-(trimethylazaniumyl)phenyl]hexan-3-yl]phenyl]azanium,diiodide? |
| A: InChIKey of trimethyl-[4-[4-[4-(trimethylazaniumyl)phenyl]hexan-3-yl]phenyl]azanium,diiodide is CLMIEWJBSVHIJU-UHFFFAOYSA-L. |
| Q: What is the molecular weight of trimethyl-[4-[4-[4-(trimethylazaniumyl)phenyl]hexan-3-yl]phenyl]azanium,diiodide? |
| A: Molecular weight of trimethyl-[4-[4-[4-(trimethylazaniumyl)phenyl]hexan-3-yl]phenyl]azanium,diiodide is 608.38100. |
| Q: What is the molecular formula of trimethyl-[4-[4-[4-(trimethylazaniumyl)phenyl]hexan-3-yl]phenyl]azanium,diiodide? |
| A: Molecular formula of trimethyl-[4-[4-[4-(trimethylazaniumyl)phenyl]hexan-3-yl]phenyl]azanium,diiodide is C24H38I2N2. |
| Q: What is the English name of trimethyl-[4-[4-[4-(trimethylazaniumyl)phenyl]hexan-3-yl]phenyl]azanium,diiodide? |
| A: The English name of trimethyl-[4-[4-[4-(trimethylazaniumyl)phenyl]hexan-3-yl]phenyl]azanium,diiodide is trimethyl-[4-[4-[4-(trimethylazaniumyl)phenyl]hexan-3-yl]phenyl]azanium,diiodide. |
| Q: What is the CAS number of trimethyl-[4-[4-[4-(trimethylazaniumyl)phenyl]hexan-3-yl]phenyl]azanium,diiodide? |
| A: CAS number of trimethyl-[4-[4-[4-(trimethylazaniumyl)phenyl]hexan-3-yl]phenyl]azanium,diiodide is 604-92-2. |
| Q: What is the SMILES notation of trimethyl-[4-[4-[4-(trimethylazaniumyl)phenyl]hexan-3-yl]phenyl]azanium,diiodide? |
| A: SMILES notation of trimethyl-[4-[4-[4-(trimethylazaniumyl)phenyl]hexan-3-yl]phenyl]azanium,diiodide is CCC(c1ccc([N+](C)(C)C)cc1)C(CC)c1ccc([N+](C)(C)C)cc1.[I-].[I-]. |
| Q: What is the safety information for trimethyl-[4-[4-[4-(trimethylazaniumyl)phenyl]hexan-3-yl]phenyl]azanium,diiodide? |
| A: Safety information for trimethyl-[4-[4-[4-(trimethylazaniumyl)phenyl]hexan-3-yl]phenyl]azanium,diiodide: S61. |