2,7-dinitrophenanthrene-9,10-dione structure
|
Common Name | 2,7-dinitrophenanthrene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 604-94-4 | Molecular Weight | 298.20700 | |
| Density | 1.631g/cm3 | Boiling Point | 555.9ºC at 760 mmHg | |
| Molecular Formula | C14H6N2O6 | Melting Point | 302-304℃ | |
| MSDS | N/A | Flash Point | 289.4ºC | |
| Name | 2,7-dinitrophenanthrene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.631g/cm3 |
|---|---|
| Boiling Point | 555.9ºC at 760 mmHg |
| Melting Point | 302-304℃ |
| Molecular Formula | C14H6N2O6 |
| Molecular Weight | 298.20700 |
| Flash Point | 289.4ºC |
| Exact Mass | 298.02300 |
| PSA | 125.78000 |
| LogP | 3.59540 |
| Index of Refraction | 1.714 |
| InChIKey | NLYJKDKBQGPHLE-UHFFFAOYSA-N |
| SMILES | O=C1C(=O)c2cc([N+](=O)[O-])ccc2-c2ccc([N+](=O)[O-])cc21 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATAMUTATION DATA
|
| Precursor 9 | |
|---|---|
| DownStream 5 | |
|
Name: Binding affinity to S100A4 (unknown origin) assessed as inhibition of S100A4/myosin-2...
Source: ChEMBL
Target: Protein S100-A4
External Id: CHEMBL4418534
|
|
Name: In vitro inhibitory activity against the cytosolic portion of CD45 protein-tyrosine p...
Source: ChEMBL
Target: Receptor-type tyrosine-protein phosphatase C
External Id: CHEMBL655779
|
|
Name: In vitro inhibition of human T-cell proliferation
Source: ChEMBL
Target: T-cell
External Id: CHEMBL812183
|
|
Name: Cytotoxicity measured against human T-cells
Source: ChEMBL
Target: T-cell
External Id: CHEMBL812180
|
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
| 2,7-dinitro-phenanthrene-9,10-dione |
| 2.7-Dinitro-phenanthrenchinon |
| 2,7-dinitrophenanthrene-9,10-quinone |
| 2,7-Dinitro-phenanthren-9,10-dion |
| 2,7-Dinitro-9,10-phenanthrenedione |
| 2:7-dinitro-phenanthraquinone |
| Phenanthrenequinone,2,7-dinitro |
| 2,7-dinitro-9,10-phenanthrenequinone |
| 2,7-Dinitrophenanthrenequinone |