(15α,19E)-Sarpagan-17-ol
(15α,19E)-Sarpagan-17-ol structure
|
Common Name | (15α,19E)-Sarpagan-17-ol | ||
|---|---|---|---|---|
| CAS Number | 604-99-9 | Molecular Weight | 294.391 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 472.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C19H22N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.7±28.7 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 10-deoxysarpagine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 472.7±45.0 °C at 760 mmHg |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.391 |
| Flash Point | 239.7±28.7 °C |
| Exact Mass | 294.173218 |
| PSA | 39.26000 |
| LogP | 2.74 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.706 |
| InChIKey | VXTDUGOBAOLMED-GJKVQYCKSA-N |
| SMILES | CC=C1CN2C3CC1C(CO)C2Cc1c3[nH]c2ccccc12 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Analgesic activity in Kunming mouse assessed as inhibition of acetic acid-induced wri...
Source: ChEMBL
Target: Mus musculus
External Id: CHEMBL4821377
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (15α,19E)-Sarpagan-17-ol |
| Tombozine |
| (19E)-Sarpagan-17-ol |
| Sarpagan-17-ol |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 10-deoxysarpagine have? |
| A: English synonyms of 10-deoxysarpagine: (15α,19E)-Sarpagan-17-ol, Tombozine, (19E)-Sarpagan-17-ol, Sarpagan-17-ol. |
| Q: What is the molecular weight of 10-deoxysarpagine? |
| A: Molecular weight of 10-deoxysarpagine is 294.391. |
| Q: What is the SMILES notation of 10-deoxysarpagine? |
| A: SMILES notation of 10-deoxysarpagine is CC=C1CN2C3CC1C(CO)C2Cc1c3[nH]c2ccccc12. |
| Q: What is the LogP of 10-deoxysarpagine? |
| A: LogP of 10-deoxysarpagine is 2.74. |
| Q: What is the polar surface area (PSA) of 10-deoxysarpagine? |
| A: Polar surface area (PSA) of 10-deoxysarpagine is 39.26000. |
| Q: What is the boiling point of 10-deoxysarpagine? |
| A: Boiling point of 10-deoxysarpagine is 472.7±45.0 °C at 760 mmHg. |
| Q: What is the CAS number of 10-deoxysarpagine? |
| A: CAS number of 10-deoxysarpagine is 604-99-9. |
| Q: What is the molecular formula of 10-deoxysarpagine? |
| A: Molecular formula of 10-deoxysarpagine is C19H22N2O. |
| Q: What is the English name of 10-deoxysarpagine? |
| A: The English name of 10-deoxysarpagine is 10-deoxysarpagine. |
| Q: What is the InChIKey of 10-deoxysarpagine? |
| A: InChIKey of 10-deoxysarpagine is VXTDUGOBAOLMED-GJKVQYCKSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| BioBioPha |
| Dayang Chem (Hangzhou) Co., Ltd. |
| naturewill |