4-[di(methyl)amino]-1,5-dimethyl-2-phenylpyrazol-3-one structure
|
Common Name | 4-[di(methyl)amino]-1,5-dimethyl-2-phenylpyrazol-3-one | ||
|---|---|---|---|---|
| CAS Number | 60433-90-1 | Molecular Weight | 233.27900 | |
| Density | 1.17g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H17N3O | Melting Point | 107-109ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | 4-[di(methyl)amino]-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Melting Point | 107-109ºC(lit.) |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 233.27900 |
| Exact Mass | 233.14400 |
| PSA | 30.17000 |
| LogP | 1.55040 |
| Index of Refraction | 1.614 |
| InChIKey | RMMXTBMQSGEXHJ-SUEIGJEOSA-N |
| SMILES | Cc1c(N(C)C)c(=O)n(-c2ccccc2)n1C |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H315-H319-H335 |
| Precautionary Statements | Missing Phrase - N15.00950417-P305 + P351 + P338 |
| Hazard Codes | Xn |
| Risk Phrases | 20/21/22 |
| Safety Phrases | 36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933199090 |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| aminopyrine-N,N-dimethyl-13C2 |
| MFCD00083940 |
| I05-3322 |
| 4-dimethylamino-1,5-dimethyl-2-phenyl-1,2-dihydro-pyrazol-3-one |