5-chloro-1-methyl-1H-indole-2,3-dione structure
|
Common Name | 5-chloro-1-methyl-1H-indole-2,3-dione | ||
|---|---|---|---|---|
| CAS Number | 60434-13-1 | Molecular Weight | 195.60200 | |
| Density | 1.454g/cm3 | Boiling Point | 344.9ºC at 760 mmHg | |
| Molecular Formula | C9H6ClNO2 | Melting Point | 177 °C | |
| MSDS | N/A | Flash Point | 162.4ºC | |
| Name | 5-Chloro-1-methylindoline-2,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.454g/cm3 |
|---|---|
| Boiling Point | 344.9ºC at 760 mmHg |
| Melting Point | 177 °C |
| Molecular Formula | C9H6ClNO2 |
| Molecular Weight | 195.60200 |
| Flash Point | 162.4ºC |
| Exact Mass | 195.00900 |
| PSA | 37.38000 |
| LogP | 1.56410 |
| Index of Refraction | 1.619 |
| InChIKey | NJOPQQPDPYWFFA-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C(=O)c2cc(Cl)ccc21 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| Precursor 10 | |
|---|---|
| DownStream 4 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-chloro-1-methylindole-2,3-dione |