5-(4-Methylphenyl)-1H-imidazol-2-amine structure
|
Common Name | 5-(4-Methylphenyl)-1H-imidazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 60472-16-4 | Molecular Weight | 173.21400 | |
| Density | 1.196g/cm3 | Boiling Point | 419.5ºC at 760 mmHg | |
| Molecular Formula | C10H11N3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 237ºC | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 5-(4-Methylphenyl)-1H-imidazol-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.196g/cm3 |
|---|---|
| Boiling Point | 419.5ºC at 760 mmHg |
| Molecular Formula | C10H11N3 |
| Molecular Weight | 173.21400 |
| Flash Point | 237ºC |
| Exact Mass | 173.09500 |
| PSA | 54.70000 |
| LogP | 2.54850 |
| Index of Refraction | 1.643 |
| InChIKey | WUUWJSLGMMTAGF-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2cnc(N)[nH]2)cc1 |
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H318 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933290090 |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-(4-Methylphenyl)-1H-iMidazol-2-aMine |