2-(4-methoxyphenyl)imino-3-methyl-6-(4-pyridin-2-ylpiperazine-1-carbonyl)-1,3-thiazinan-4-one structure
|
Common Name | 2-(4-methoxyphenyl)imino-3-methyl-6-(4-pyridin-2-ylpiperazine-1-carbonyl)-1,3-thiazinan-4-one | ||
|---|---|---|---|---|
| CAS Number | 6048-78-8 | Molecular Weight | 439.53100 | |
| Density | 1.33g/cm3 | Boiling Point | 672ºC at 760 mmHg | |
| Molecular Formula | C22H25N5O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 360.2ºC | |
| Name | 2-(4-methoxyphenyl)imino-3-methyl-6-(4-pyridin-2-ylpiperazine-1-carbonyl)-1,3-thiazinan-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 672ºC at 760 mmHg |
| Molecular Formula | C22H25N5O3S |
| Molecular Weight | 439.53100 |
| Flash Point | 360.2ºC |
| Exact Mass | 439.16800 |
| PSA | 103.64000 |
| LogP | 2.33120 |
| Index of Refraction | 1.667 |
| InChIKey | AGVWTPKCAOPWPH-UHFFFAOYSA-N |
| SMILES | COc1ccc(N=C2SC(C(=O)N3CCN(c4ccccn4)CC3)CC(=O)N2C)cc1 |
|
~%
2-(4-methoxyphe... CAS#:6048-78-8 |
| Literature: Anderson; Pollard Journal of the American Chemical Society, 1939 , vol. 61, p. 3439 |
|
~%
2-(4-methoxyphe... CAS#:6048-78-8 |
| Literature: Mahboob; Dhar Journal of Scientific and Industrial Research, 1955 , vol. 14 B, p. 1,3 |
| HMS620N22 |
| 1,9-dimorpholino-nonane |