9,10-Anthracenedione,2,6-dichloro structure
|
Common Name | 9,10-Anthracenedione,2,6-dichloro | ||
|---|---|---|---|---|
| CAS Number | 605-40-3 | Molecular Weight | 277.10200 | |
| Density | 1.514g/cm3 | Boiling Point | 455.2ºC at 760 mmHg | |
| Molecular Formula | C14H6Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.7ºC | |
| Name | 2,6-dichloroanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.514g/cm3 |
|---|---|
| Boiling Point | 455.2ºC at 760 mmHg |
| Molecular Formula | C14H6Cl2O2 |
| Molecular Weight | 277.10200 |
| Flash Point | 191.7ºC |
| Exact Mass | 275.97400 |
| PSA | 34.14000 |
| LogP | 3.76880 |
| Index of Refraction | 1.671 |
| InChIKey | KJGPMAHVCDFRBN-UHFFFAOYSA-N |
| SMILES | O=C1c2ccc(Cl)cc2C(=O)c2ccc(Cl)cc21 |
| Precursor 10 | |
|---|---|
| DownStream 4 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 9,2,6-dichloro |
| Anthraquinone,2,6-dichloro |
| 2,6-dichloro-9,10-anthraquinone |
| 2,6-Dichlor-anthrachinon |
| 2,6-dichloro-9,10-anthracenedione |
| Anthraquinone,6-dichloro |
| 2,6-Dichloranthrachinon-(9,10) |
| 2,6-dichloro-anthraquinone |