2,6-Diaminoanthraquinone structure
|
Common Name | 2,6-Diaminoanthraquinone | ||
|---|---|---|---|---|
| CAS Number | 131-14-6 | Molecular Weight | 238.241 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 551.9±50.0 °C at 760 mmHg | |
| Molecular Formula | C14H10N2O2 | Melting Point | >325 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 287.6±30.1 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,6-Diaminoanthraquinone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 551.9±50.0 °C at 760 mmHg |
| Melting Point | >325 °C(lit.) |
| Molecular Formula | C14H10N2O2 |
| Molecular Weight | 238.241 |
| Flash Point | 287.6±30.1 °C |
| Exact Mass | 238.074234 |
| PSA | 86.18000 |
| LogP | 2.12 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.757 |
| InChIKey | WQOWBWVMZPPPGX-UHFFFAOYSA-N |
| SMILES | Nc1ccc2c(c1)C(=O)c1ccc(N)cc1C2=O |
| Stability | Stable. Incompatible with strong oxidizing agents. |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | CB6450000 |
| HS Code | 2922399090 |
|
~%
2,6-Diaminoanth... CAS#:131-14-6 |
| Literature: Journal of Organic Chemistry, , vol. 71, # 26 p. 9651 - 9657 |
|
~%
2,6-Diaminoanth... CAS#:131-14-6 |
| Literature: DE295624 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 13, p. 398 |
|
~%
2,6-Diaminoanth... CAS#:131-14-6 |
| Literature: DE295624 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 13, p. 398 |
|
~%
2,6-Diaminoanth... CAS#:131-14-6 |
| Literature: DE288996 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 12, p. 412 |
| Precursor 6 | |
|---|---|
| DownStream 10 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,6-Diamino-9,10-anthraquinone |
| 2,6-diaminoanthracene-9,10-dione |
| MFCD00001234 |
| 2,6-diaminoanthra-9,10-quinone |
| 9,10-Anthracenedione, 2,6-diamino- |
| 2,6-Diaminoanthraquinone |
| EINECS 205-013-7 |