2-(4-nitrophenoxy)-N-pyridin-3-yl-acetamide structure
|
Common Name | 2-(4-nitrophenoxy)-N-pyridin-3-yl-acetamide | ||
|---|---|---|---|---|
| CAS Number | 60521-02-0 | Molecular Weight | 273.24400 | |
| Density | 1.394g/cm3 | Boiling Point | 562.1ºC at 760 mmHg | |
| Molecular Formula | C13H11N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 293.7ºC | |
| Name | 2-(4-nitrophenoxy)-N-pyridin-3-ylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.394g/cm3 |
|---|---|
| Boiling Point | 562.1ºC at 760 mmHg |
| Molecular Formula | C13H11N3O4 |
| Molecular Weight | 273.24400 |
| Flash Point | 293.7ºC |
| Exact Mass | 273.07500 |
| PSA | 97.04000 |
| LogP | 2.60350 |
| Index of Refraction | 1.649 |
| InChIKey | ZTYZUHJJPSWCKL-UHFFFAOYSA-N |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1)Nc1cccnc1 |
|
~%
2-(4-nitropheno... CAS#:60521-02-0 |
| Literature: Xia, Shuai; Wang, Li-Ying; Sun, Heng-Zhi; Yue, Huan; Wang, Xiu-Hua; Tan, Jia-Lian; Wang, Yin; Hou, Di; He, Xiao-Yan; Mun, Ki-Cheol; Kumar, B. Prem; Zuo, Hua; Shin, Dong-Soo Bulletin of the Korean Chemical Society, 2013 , vol. 34, # 2 p. 394 - 398 |
|
~%
2-(4-nitropheno... CAS#:60521-02-0 |
| Literature: Xia, Shuai; Wang, Li-Ying; Sun, Heng-Zhi; Yue, Huan; Wang, Xiu-Hua; Tan, Jia-Lian; Wang, Yin; Hou, Di; He, Xiao-Yan; Mun, Ki-Cheol; Kumar, B. Prem; Zuo, Hua; Shin, Dong-Soo Bulletin of the Korean Chemical Society, 2013 , vol. 34, # 2 p. 394 - 398 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| acetamide,2-(4-nitrophenoxy)-n-3-pyridinyl |
| 2-(4-nitrophenoxy)-N-(pyridin-3-yl)acetamide |