1-(1,1-Dimethylheptyl)-3,5-dimethoxybenzene structure
|
Common Name | 1-(1,1-Dimethylheptyl)-3,5-dimethoxybenzene | ||
|---|---|---|---|---|
| CAS Number | 60526-81-0 | Molecular Weight | 264.40300 | |
| Density | 0.943 | Boiling Point | 122ºC (0.5 MMHG) | |
| Molecular Formula | C17H28O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | >110ºC | |
| Name | 1,3-dimethoxy-5-(2-methyloctan-2-yl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 0.943 |
|---|---|
| Boiling Point | 122ºC (0.5 MMHG) |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.40300 |
| Flash Point | >110ºC |
| Exact Mass | 264.20900 |
| PSA | 18.46000 |
| LogP | 4.95180 |
| Index of Refraction | 1.5 |
| InChIKey | MYYOUJBZUGHFNX-UHFFFAOYSA-N |
| SMILES | CCCCCCC(C)(C)c1cc(OC)cc(OC)c1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2909309090 |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| einecs 262-280-2 |
| MFCD04974108 |